Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D166539-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$499.90
|
|
Discover 4-(Difluoromethyl)-1,2-difluorobenzene by Aladdin Scientific in for only $499.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 4-(DIFLUOROMETHYL)-1,2-DIFLUOROBENZENE | 1214379-64-2 | 3,4-Difluorobenzal fluoride | MFCD14698573 | DTXSID40673318 | UTOWIQSPHDVGDF-UHFFFAOYSA-N | BBL101530 | STL555326 | AKOS005259382 | CS-0455173 | FT-0682931 | 4-(Difluoromethyl)-1,2-difluorobenzene, AldrichCPR | 4-(Difluorom |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fluorobenzenes |
| Alternative Parents | Aryl fluorides Organofluorides Hydrofluorocarbons Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Fluorobenzene - Aryl halide - Aryl fluoride - Hydrofluorocarbon - Hydrocarbon derivative - Organofluoride - Organohalogen compound - Alkyl halide - Alkyl fluoride - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as fluorobenzenes. These are compounds containing one or more fluorine atoms attached to a benzene ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-(difluoromethyl)-1,2-difluorobenzene |
|---|---|
| INCHI | InChI=1S/C7H4F4/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,7H |
| InChIKey | UTOWIQSPHDVGDF-UHFFFAOYSA-N |
| Smiles | C1=CC(=C(C=C1C(F)F)F)F |
| Isomeric SMILES | C1=CC(=C(C=C1C(F)F)F)F |
| Molecular Weight | 164.1 |
| Reaxy-Rn | 39113498 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=39113498&ln= |
| Molecular Weight | 164.100 g/mol |
|---|---|
| XLogP3 | 2.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 164.025 Da |
| Monoisotopic Mass | 164.025 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 126.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |