Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C187260-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,194.90
|
|
Discover 4-(Cyclopentanesulfonyl)aniline by Aladdin Scientific in 97% for only $1,194.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 4-(cyclopentylsulfonyl)aniline | 86810-83-5 | 4-(Cyclopentanesulfonyl)aniline | 4-cyclopentylsulfonylaniline | SCHEMBL2148808 | DTXSID30514009 | RVGOJORVZBRFCG-UHFFFAOYSA-N | MFCD10666938 | AKOS009228428 | BS-32938 | CS-0205805 | EN300-33648 | H11865 | A863037 | Z359291938 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Aniline and substituted anilines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Sulfonylanilines |
| Alternative Parents | Benzenesulfonyl compounds Sulfones Primary amines Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Sulfonylaniline - Benzenesulfonyl group - Sulfonyl - Sulfone - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Primary amine - Organosulfur compound - Organonitrogen compound - Amine - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as sulfonylanilines. These are compounds containing an aniline moiety, which is para-substituted by a sulfonyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-cyclopentylsulfonylaniline |
|---|---|
| INCHI | InChI=1S/C11H15NO2S/c12-9-5-7-11(8-6-9)15(13,14)10-3-1-2-4-10/h5-8,10H,1-4,12H2 |
| InChIKey | RVGOJORVZBRFCG-UHFFFAOYSA-N |
| Smiles | C1CCC(C1)S(=O)(=O)C2=CC=C(C=C2)N |
| Isomeric SMILES | C1CCC(C1)S(=O)(=O)C2=CC=C(C=C2)N |
| Molecular Weight | 225.3 |
| Reaxy-Rn | 6509405 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=6509405&ln= |
| Molecular Weight | 225.310 g/mol |
|---|---|
| XLogP3 | 1.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 225.082 Da |
| Monoisotopic Mass | 225.082 Da |
| Topological Polar Surface Area | 68.500 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 293.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |