Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C188229-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,596.90
|
|
Discover 4-Cyano-3-(trifluoromethyl)phenylboronic acid by Aladdin Scientific in 95% for only $2,596.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 915299-32-0 | 4-Cyano-3-(trifluoromethyl)phenylboronic acid | (4-Cyano-3-(trifluoromethyl)phenyl)boronic acid | [4-Cyano-3-(trifluoromethyl)phenyl]boronic acid | (4-Cyano-3-(trifluoromethyl)phenyl)boronicacid | Boronic acid, B-[4-cyano-3-(trifluoromethyl)phenyl]- | D |
|---|---|
| Specifications & Purity | ≥95% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Trifluoromethylbenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Trifluoromethylbenzenes |
| Alternative Parents | Benzonitriles Boronic acids Organic metalloid salts Nitriles Organopnictogen compounds Organometalloid compounds Organofluorides Organic oxygen compounds Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Trifluoromethylbenzene - Benzonitrile - Boronic acid derivative - Boronic acid - Carbonitrile - Nitrile - Organic metalloid salt - Alkyl fluoride - Organonitrogen compound - Organofluoride - Organic metalloid moeity - Organohalogen compound - Hydrocarbon derivative - Cyanide - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Alkyl halide - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as trifluoromethylbenzenes. These are organofluorine compounds that contain a benzene ring substituted with one or more trifluoromethyl groups. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | [4-cyano-3-(trifluoromethyl)phenyl]boronic acid |
|---|---|
| INCHI | InChI=1S/C8H5BF3NO2/c10-8(11,12)7-3-6(9(14)15)2-1-5(7)4-13/h1-3,14-15H |
| InChIKey | YBQDFMCBPJKZJZ-UHFFFAOYSA-N |
| Smiles | B(C1=CC(=C(C=C1)C#N)C(F)(F)F)(O)O |
| Isomeric SMILES | B(C1=CC(=C(C=C1)C#N)C(F)(F)F)(O)O |
| Molecular Weight | 214.9 |
| Reaxy-Rn | 10439639 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=10439639&ln= |
| Molecular Weight | 214.940 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 1 |
| Exact Mass | 215.037 Da |
| Monoisotopic Mass | 215.037 Da |
| Topological Polar Surface Area | 64.300 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 273.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |