Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C172335-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$568.90
|
|
Discover 4-(chloromethyl)-3-methylpyridine hydrochloride by Aladdin Scientific in 97% for only $568.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 4-(Chloromethyl)-3-methylpyridine hydrochloride | 117934-36-8 | 4-(CHLOROMETHYL)-3-METHYLPYRIDINE HCL | 4-(chloromethyl)-3-methylpyridine;hydrochloride | MFCD20527162 | SCHEMBL20475309 | AKOS030254157 | SB19862 | AS-50996 | SY099763 | 4-Chloromethyl-3-methylpyridine hydrochl |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Methylpyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Methylpyridines |
| Alternative Parents | Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organochlorides Hydrochlorides Hydrocarbon derivatives Alkyl chlorides |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Methylpyridine - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Hydrochloride - Organonitrogen compound - Organochloride - Organohalogen compound - Alkyl halide - Alkyl chloride - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as methylpyridines. These are organic compounds containing a pyridine ring substituted at one or more positions by a methyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-(chloromethyl)-3-methylpyridine;hydrochloride |
|---|---|
| INCHI | InChI=1S/C7H8ClN.ClH/c1-6-5-9-3-2-7(6)4-8;/h2-3,5H,4H2,1H3;1H |
| InChIKey | ACAQSRMVBOXHLG-UHFFFAOYSA-N |
| Smiles | CC1=C(C=CN=C1)CCl.Cl |
| Isomeric SMILES | CC1=C(C=CN=C1)CCl.Cl |
| PubChem CID | 121237799 |
| Molecular Weight | 178.06 |
| Molecular Weight | 178.060 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 1 |
| Exact Mass | 177.011 Da |
| Monoisotopic Mass | 177.011 Da |
| Topological Polar Surface Area | 12.900 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 85.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |