Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C178720-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,855.90
|
|
Discover 4-Chloro-2-methoxypyridine-3-carbaldehyde by Aladdin Scientific in 98% for only $1,855.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 1008451-58-8 | 4-Chloro-2-methoxynicotinaldehyde | 4-chloro-2-methoxypyridine-3-carbaldehyde | 4-CHLORO-2-METHOXY-PYRIDINE-3-CARBALDEHYDE | MFCD13188720 | 3-PYRIDINECARBOXALDEHYDE, 4-CHLORO-2-METHOXY- | SCHEMBL438652 | AMY8068 | DTXSID90696118 | FURZPPOFSODEOQ-UHFFFAOYSA-N |
|---|---|
| Specifications & Purity | ≥98% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Pyridine carboxaldehydes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyridine carboxaldehydes |
| Alternative Parents | Aryl-aldehydes Alkyl aryl ethers Aryl chlorides Vinylogous halides Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organochlorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 3-pyridine carboxaldehyde - Alkyl aryl ether - Aryl-aldehyde - Aryl chloride - Aryl halide - Heteroaromatic compound - Vinylogous halide - Ether - Azacycle - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Aldehyde - Organic oxide - Organic oxygen compound - Hydrocarbon derivative - Organic nitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyridine carboxaldehydes. These are aromatic compounds containing a pyridine ring which bears a carboxaldehyde group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-chloro-2-methoxypyridine-3-carbaldehyde |
|---|---|
| INCHI | InChI=1S/C7H6ClNO2/c1-11-7-5(4-10)6(8)2-3-9-7/h2-4H,1H3 |
| InChIKey | FURZPPOFSODEOQ-UHFFFAOYSA-N |
| Smiles | COC1=NC=CC(=C1C=O)Cl |
| Isomeric SMILES | COC1=NC=CC(=C1C=O)Cl |
| Molecular Weight | 171.6 |
| Reaxy-Rn | 19606331 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=19606331&ln= |
| Molecular Weight | 171.580 g/mol |
|---|---|
| XLogP3 | 1.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 171.009 Da |
| Monoisotopic Mass | 171.009 Da |
| Topological Polar Surface Area | 39.200 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 142.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |