Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C638209-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$801.90
|
|
| Synonyms | DTXSID301298233 | AKOS005174151 | SCHEMBL15651802 | 4-chloro-1H-pyrazole-3-carboxamide | SY322750 | E79873 | EN300-7024033 | MFCD15146442 | 4-chloro-1H-pyrazole-5-carboxamide | LS-04180 | SCHEMBL2591837 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Carboxylic acid derivatives |
| Intermediate Tree Nodes | Carboxylic acid amides |
| Direct Parent | 2-heteroaryl carboxamides |
| Alternative Parents | Pyrazole-5-carboxamides Aryl chlorides Vinylogous halides Heteroaromatic compounds Primary carboxylic acid amides Azacyclic compounds Organooxygen compounds Organonitrogen compounds Organochlorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 2-heteroaryl carboxamide - Pyrazole-5-carboxamide - Aryl chloride - Aryl halide - Azole - Pyrazole - Vinylogous halide - Heteroaromatic compound - Primary carboxylic acid amide - Organoheterocyclic compound - Azacycle - Organic oxygen compound - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Hydrocarbon derivative - Organic oxide - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 2-heteroaryl carboxamides. These are compounds containing a heteroaromatic ring that carries a carboxamide group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-chloro-1H-pyrazole-5-carboxamide |
|---|---|
| INCHI | InChI=1S/C4H4ClN3O/c5-2-1-7-8-3(2)4(6)9/h1H,(H2,6,9)(H,7,8) |
| InChIKey | BSRADBHDGBSUDE-UHFFFAOYSA-N |
| Smiles | C1=NNC(=C1Cl)C(=O)N |
| Isomeric SMILES | C1=NNC(=C1Cl)C(=O)N |
| Alternate CAS | 33064-37-8 |
| PubChem CID | 46318315 |
| Molecular Weight | 145.55 |
| Molecular Weight | 145.550 g/mol |
|---|---|
| XLogP3 | 0.100 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 145.004 Da |
| Monoisotopic Mass | 145.004 Da |
| Topological Polar Surface Area | 71.800 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 129.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |