Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B184715-1g
|
1g |
5
|
$45.90
|
|
|
B184715-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$107.90
|
|
| Synonyms | 4-Butoxy-3-chlorophenylboronic acid | 480438-55-9 | (4-butoxy-3-chlorophenyl)boronic acid | MFCD04974064 | SCHEMBL257737 | DTXSID50409524 | AOKJNAVCTPBFPJ-UHFFFAOYSA-N | AMY29935 | (4-butoxy-3-chlorophenyl)boronicacid | AKOS004114016 | AB21453 | CS-W000941 | BP-12103 | DS-18082 | SY |
|---|---|
| Specifications & Purity | ≥96% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenol ethers |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenol ethers |
| Alternative Parents | Phenoxy compounds Chlorobenzenes Alkyl aryl ethers Aryl chlorides Boronic acids Organic metalloid salts Organometalloid compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxy compound - Phenol ether - Alkyl aryl ether - Chlorobenzene - Halobenzene - Aryl chloride - Aryl halide - Monocyclic benzene moiety - Boronic acid - Boronic acid derivative - Organic metalloid salt - Ether - Organohalogen compound - Hydrocarbon derivative - Organic oxygen compound - Organic metalloid moeity - Organochloride - Organooxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenol ethers. These are aromatic compounds containing an ether group substituted with a benzene ring. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504763257 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504763257 |
| IUPAC Name | (4-butoxy-3-chlorophenyl)boronic acid |
| INCHI | InChI=1S/C10H14BClO3/c1-2-3-6-15-10-5-4-8(11(13)14)7-9(10)12/h4-5,7,13-14H,2-3,6H2,1H3 |
| InChIKey | AOKJNAVCTPBFPJ-UHFFFAOYSA-N |
| Smiles | B(C1=CC(=C(C=C1)OCCCC)Cl)(O)O |
| Isomeric SMILES | B(C1=CC(=C(C=C1)OCCCC)Cl)(O)O |
| Molecular Weight | 228.5 |
| Reaxy-Rn | 18349626 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=18349626&ln= |
| Melt Point(°C) | 147-151 °C |
|---|---|
| Molecular Weight | 228.480 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 5 |
| Exact Mass | 228.072 Da |
| Monoisotopic Mass | 228.072 Da |
| Topological Polar Surface Area | 49.700 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 180.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |