Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B187311-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$33.90
|
|
|
B187311-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$152.90
|
|
Discover 4-Butoxy-2,3,5,6-tetrafluorophenylboronic acid by Aladdin Scientific in 98% for only $33.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 871126-19-1 | (4-butoxy-2,3,5,6-tetrafluorophenyl)boronic acid | 4-Butoxy-2,3,5,6-tetrafluorophenylboronic acid | 4-Butoxy-2,3,5,6-tetrafluorobenzeneboronic acid | (4-Butoxy-2,3,5,6-tetrafluorophenyl)boronicacid | SCHEMBL257750 | DTXSID90584708 | MFCD07784382 | AKOS01583 |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenol ethers |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenol ethers |
| Alternative Parents | Phenoxy compounds Fluorobenzenes Alkyl aryl ethers Aryl fluorides Boronic acids Organic metalloid salts Organofluorides Organoboron compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxy compound - Phenol ether - Alkyl aryl ether - Halobenzene - Fluorobenzene - Aryl fluoride - Aryl halide - Monocyclic benzene moiety - Boronic acid derivative - Boronic acid - Organic metalloid salt - Ether - Organic oxygen compound - Organohalogen compound - Organoboron compound - Organofluoride - Organooxygen compound - Organic salt - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenol ethers. These are aromatic compounds containing an ether group substituted with a benzene ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (4-butoxy-2,3,5,6-tetrafluorophenyl)boronic acid |
|---|---|
| INCHI | InChI=1S/C10H11BF4O3/c1-2-3-4-18-10-8(14)6(12)5(11(16)17)7(13)9(10)15/h16-17H,2-4H2,1H3 |
| InChIKey | DXYUAQQPCWNJQX-UHFFFAOYSA-N |
| Smiles | B(C1=C(C(=C(C(=C1F)F)OCCCC)F)F)(O)O |
| Isomeric SMILES | B(C1=C(C(=C(C(=C1F)F)OCCCC)F)F)(O)O |
| WGK Germany | 3 |
| Molecular Weight | 266 |
| Reaxy-Rn | 18349840 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=18349840&ln= |
| Molecular Weight | 266.000 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 5 |
| Exact Mass | 266.074 Da |
| Monoisotopic Mass | 266.074 Da |
| Topological Polar Surface Area | 49.700 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 243.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |