Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B494196-250mg
|
250mg |
4
|
$110.90
|
|
|
B494196-1g
|
1g |
1
|
$300.90
|
|
| Synonyms | 206559-45-7 | 2-(4-bromophenyl)ethanamine Hydrobromide | 4-Bromophenethylamine hydrobromide | 2-(4-bromophenyl)ethanamine;hydrobromide | 2-(4-bromophenyl)ethylamine hydrobromide | 4-Bromophenethylaminehydrobromide | 2-(4-Bromophenyl)Ethan-1-Amine Hydrobromide | SCHEMBL |
|---|---|
| Specifications & Purity | ≥99%(4 Times Purification) |
| Storage Temp | Protected from light,Room temperature,Argon charged |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Phenethylamines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenethylamines |
| Alternative Parents | Bromobenzenes Aralkylamines Aryl bromides Organopnictogen compounds Organobromides Organic bromide salts Monoalkylamines Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenethylamine - Bromobenzene - Halobenzene - Aralkylamine - Aryl bromide - Aryl halide - Organic salt - Primary amine - Organic nitrogen compound - Organonitrogen compound - Organobromide - Organohalogen compound - Primary aliphatic amine - Amine - Organic bromide salt - Hydrocarbon derivative - Organopnictogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenethylamines. These are compounds containing a phenethylamine moiety, which consists of a phenyl group substituted at the second position by an ethan-1-amine. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488193052 |
|---|---|
| IUPAC Name | 2-(4-bromophenyl)ethanamine;hydrobromide |
| INCHI | InChI=1S/C8H10BrN.BrH/c9-8-3-1-7(2-4-8)5-6-10;/h1-4H,5-6,10H2;1H |
| InChIKey | IUWPMHYAMOUYKQ-UHFFFAOYSA-N |
| Smiles | C1=CC(=CC=C1CCN)Br.Br |
| Isomeric SMILES | C1=CC(=CC=C1CCN)Br.Br |
| PubChem CID | 2757090 |
| Molecular Weight | 280.99 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jun 17, 2023 | B494196 | |
| Certificate of Analysis | Jun 17, 2023 | B494196 | |
| Certificate of Analysis | Jun 17, 2023 | B494196 | |
| Certificate of Analysis | Jun 17, 2023 | B494196 |
| Solubility | Soluble in mostly organic solvent |
|---|---|
| Sensitivity | Moisture sensitive;air sensitive;light sensitive |
| Melt Point(°C) | 272-274° |
| Molecular Weight | 280.990 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 2 |
| Exact Mass | 280.924 Da |
| Monoisotopic Mass | 278.926 Da |
| Topological Polar Surface Area | 26.000 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 87.300 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |