Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B169791-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$410.90
|
|
| Synonyms | 4-Bromo-4'-ethoxybenzophenone | 351003-30-0 | (4-bromophenyl)-(4-ethoxyphenyl)methanone | 3-BROMO-4'-ETHOXYBENZOPHENONE 97 | MFCD00617163 | (4-BROMOPHENYL)(4-ETHOXYPHENYL)METHANONE | DTXSID60399063 | AKOS006031462 | CS-0362973 | (4-Bromo-phenyl)-(4-ethoxy-phenyl)-methanon |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzophenones |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzophenones |
| Alternative Parents | Diphenylmethanes Aryl-phenylketones Phenoxy compounds Phenol ethers Benzoyl derivatives Bromobenzenes Alkyl aryl ethers Aryl bromides Organobromides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Benzophenone - Diphenylmethane - Aryl-phenylketone - Phenoxy compound - Benzoyl - Phenol ether - Aryl ketone - Halobenzene - Bromobenzene - Alkyl aryl ether - Aryl bromide - Aryl halide - Ketone - Ether - Organooxygen compound - Organobromide - Organohalogen compound - Organic oxygen compound - Hydrocarbon derivative - Organic oxide - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzophenones. These are organic compounds containing a ketone attached to two phenyl groups. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (4-bromophenyl)-(4-ethoxyphenyl)methanone |
|---|---|
| INCHI | InChI=1S/C15H13BrO2/c1-2-18-14-9-5-12(6-10-14)15(17)11-3-7-13(16)8-4-11/h3-10H,2H2,1H3 |
| InChIKey | CTFATYIGPWOEMM-UHFFFAOYSA-N |
| Smiles | CCOC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)Br |
| Isomeric SMILES | CCOC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)Br |
| Molecular Weight | 305.17 |
| Reaxy-Rn | 1967490 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1967490&ln= |
| Molecular Weight | 305.170 g/mol |
|---|---|
| XLogP3 | 4.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 4 |
| Exact Mass | 304.01 Da |
| Monoisotopic Mass | 304.01 Da |
| Topological Polar Surface Area | 26.300 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 264.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |