Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A174477-100mg
|
100mg |
3
|
$58.90
|
|
|
A174477-250mg
|
250mg |
3
|
$84.90
|
|
| Synonyms | 1523618-06-5 | 4-AMINO-2-PIPERIDINONE TRIFLUOROACETATE | 4-aminopiperidin-2-one trifluoroacetate | 4-Aminopiperidin-2-one 2,2,2-trifluoroacetate | 4-aminopiperidin-2-one;2,2,2-trifluoroacetic acid | MFCD17016140 | 4-aminopiperidin-2-one 2,2,2-trifluoroacetate salt | 4- |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at 2-8°C,Argon charged |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives |
| Direct Parent | Beta amino acids and derivatives |
| Alternative Parents | Piperidinones Delta lactams Aminopiperidines Alpha-halocarboxylic acids Secondary carboxylic acid amides Monocarboxylic acids and derivatives Carboxylic acids Azacyclic compounds Organofluorides Organic oxides Monoalkylamines Hydrocarbon derivatives Carbonyl compounds Alkyl fluorides |
| Molecular Framework | Not available |
| Substituents | Beta amino acid or derivatives - 4-aminopiperidine - Delta-lactam - Piperidinone - Piperidine - Alpha-halocarboxylic acid - Alpha-halocarboxylic acid or derivatives - Carboxamide group - Secondary carboxylic acid amide - Lactam - Azacycle - Carboxylic acid - Organoheterocyclic compound - Monocarboxylic acid or derivatives - Organic nitrogen compound - Primary aliphatic amine - Primary amine - Alkyl halide - Alkyl fluoride - Carbonyl group - Hydrocarbon derivative - Organic oxide - Amine - Organic oxygen compound - Organohalogen compound - Organofluoride - Organonitrogen compound - Organooxygen compound - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as beta amino acids and derivatives. These are amino acids having a (-NH2) group attached to the beta carbon atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-aminopiperidin-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| INCHI | InChI=1S/C5H10N2O.C2HF3O2/c6-4-1-2-7-5(8)3-4;3-2(4,5)1(6)7/h4H,1-3,6H2,(H,7,8);(H,6,7) |
| InChIKey | UKOAYNOFHRXZEE-UHFFFAOYSA-N |
| Smiles | C1CNC(=O)CC1N.C(=O)(C(F)(F)F)O |
| Isomeric SMILES | C1CNC(=O)CC1N.C(=O)(C(F)(F)F)O |
| Molecular Weight | 228.169 |
| Reaxy-Rn | 28512306 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=28512306&ln= |
| Molecular Weight | 228.170 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 0 |
| Exact Mass | 228.072 Da |
| Monoisotopic Mass | 228.072 Da |
| Topological Polar Surface Area | 92.400 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 186.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |