Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D179639-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$76.90
|
|
Discover 4,7-Dichloro-8-fluoro-2-(trifluoromethyl)quinoline by Aladdin Scientific in 95% for only $76.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 4,7-DICHLORO-8-FLUORO-2-(TRIFLUOROMETHYL)QUINOLINE | 1150164-86-5 | DTXSID70656290 | MFCD12026031 | AKOS009868051 | SB68629 | BS-19375 | CS-0212065 | FT-0741599 | Quinoline, 4,7-dichloro-8-fluoro-2-(trifluoromethyl)- |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Quinolines and derivatives |
| Subclass | Haloquinolines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Chloroquinolines |
| Alternative Parents | Pyridines and derivatives Benzenoids Aryl fluorides Aryl chlorides Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organofluorides Organochlorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Chloroquinoline - Aryl chloride - Aryl fluoride - Aryl halide - Pyridine - Benzenoid - Heteroaromatic compound - Azacycle - Alkyl fluoride - Organonitrogen compound - Organofluoride - Organochloride - Organohalogen compound - Alkyl halide - Organic nitrogen compound - Hydrocarbon derivative - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as chloroquinolines. These are compounds containing a quinoline moiety, which carries one or more chlorine atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4,7-dichloro-8-fluoro-2-(trifluoromethyl)quinoline |
|---|---|
| INCHI | InChI=1S/C10H3Cl2F4N/c11-5-2-1-4-6(12)3-7(10(14,15)16)17-9(4)8(5)13/h1-3H |
| InChIKey | IIUHKGPQNHZIJS-UHFFFAOYSA-N |
| Smiles | C1=CC(=C(C2=C1C(=CC(=N2)C(F)(F)F)Cl)F)Cl |
| Isomeric SMILES | C1=CC(=C(C2=C1C(=CC(=N2)C(F)(F)F)Cl)F)Cl |
| PubChem CID | 43668401 |
| Molecular Weight | 284 |
| Molecular Weight | 284.030 g/mol |
|---|---|
| XLogP3 | 4.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 0 |
| Exact Mass | 282.958 Da |
| Monoisotopic Mass | 282.958 Da |
| Topological Polar Surface Area | 12.900 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 286.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |