Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D303759-250mg
|
250mg |
3
|
$80.90
|
|
|
D303759-1g
|
1g |
2
|
$197.90
|
|
| Synonyms | 4,4-Difluorocyclohexanamine | 458566-84-2 | 4,4-difluorocyclohexan-1-amine | 4,4-difluoro-cyclohexylamine | (4,4-difluorocyclohexyl)amine | MFCD06409984 | CYCLOHEXANAMINE, 4,4-DIFLUORO- | 4,4-DIFLUOROCYCLOHEXYLAMINE | 4,4-difluorocyclohexyl amine | SCHEMBL359571 | 4, 4-Diflu |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Store at 2-8°C,Desiccated |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organohalogen compounds |
| Class | Alkyl halides |
| Subclass | Cyclohexyl halides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Cyclohexyl halides |
| Alternative Parents | Cyclohexylamines Organofluorides Monoalkylamines Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Cyclohexyl halide - Cyclohexylamine - Organic nitrogen compound - Hydrocarbon derivative - Primary amine - Organonitrogen compound - Organofluoride - Primary aliphatic amine - Amine - Alkyl fluoride - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as cyclohexyl halides. These are organohalogen compounds containing a monocyclic cyclohexane moiety that is substituted at one or more positions by an halogen atom. |
| External Descriptors | Not available |
|
|
|
| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| Pubchem Sid | 504762763 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504762763 |
| IUPAC Name | 4,4-difluorocyclohexan-1-amine |
| INCHI | InChI=1S/C6H11F2N/c7-6(8)3-1-5(9)2-4-6/h5H,1-4,9H2 |
| InChIKey | MQOFXVWAFFJFJH-UHFFFAOYSA-N |
| Smiles | C1CC(CCC1N)(F)F |
| Isomeric SMILES | C1CC(CCC1N)(F)F |
| Molecular Weight | 135.16 |
| Reaxy-Rn | 11407186 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=11407186&ln= |
| Flash Point(°C) | 40℃ |
|---|---|
| Boil Point(°C) | 141℃ |
| Molecular Weight | 135.150 g/mol |
| XLogP3 | 1.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 135.086 Da |
| Monoisotopic Mass | 135.086 Da |
| Topological Polar Surface Area | 26.000 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 93.200 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |