Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D181307-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$5,480.90
|
|
| Synonyms | 1361871-90-0 | 4-(3,5-Dichlorophenyl)-2-fluorobenzaldehyde | 3',5'-Dichloro-3-fluoro-[1,1'-biphenyl]-4-carbaldehyde | DTXSID10742828 | MFCD22192557 | BS-25643 | 3',5'-Dichloro-3-fluoro-biphenyl-4-carboxaldehyde | 3',5'-Dichloro-3-fluoro[1,1'-biphenyl]-4-carbaldehyde |
|---|---|
| Specifications & Purity | ≥96% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Biphenyls and derivatives |
| Intermediate Tree Nodes | Chlorinated biphenyls |
| Direct Parent | Polychlorinated biphenyls |
| Alternative Parents | Dichlorobenzenes Benzoyl derivatives Benzaldehydes Fluorobenzenes Aryl fluorides Aryl chlorides Vinylogous halides Organofluorides Organochlorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Polychlorinated biphenyl - Benzaldehyde - Benzoyl - 1,3-dichlorobenzene - Aryl-aldehyde - Chlorobenzene - Fluorobenzene - Halobenzene - Aryl fluoride - Aryl halide - Aryl chloride - Vinylogous halide - Organooxygen compound - Organic oxygen compound - Aldehyde - Hydrocarbon derivative - Organic oxide - Organofluoride - Organohalogen compound - Organochloride - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as polychlorinated biphenyls. These are organic compounds containing at least two chlorine atoms attached to either benzene ring of the biphenyl moiety. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-(3,5-dichlorophenyl)-2-fluorobenzaldehyde |
|---|---|
| INCHI | InChI=1S/C13H7Cl2FO/c14-11-3-10(4-12(15)6-11)8-1-2-9(7-17)13(16)5-8/h1-7H |
| InChIKey | MIZDCJVWRWQQIU-UHFFFAOYSA-N |
| Smiles | C1=CC(=C(C=C1C2=CC(=CC(=C2)Cl)Cl)F)C=O |
| Isomeric SMILES | C1=CC(=C(C=C1C2=CC(=CC(=C2)Cl)Cl)F)C=O |
| PubChem CID | 70699714 |
| Molecular Weight | 269.1 |
| Molecular Weight | 269.090 g/mol |
|---|---|
| XLogP3 | 4.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 267.986 Da |
| Monoisotopic Mass | 267.986 Da |
| Topological Polar Surface Area | 17.100 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 264.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |