Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D167771-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$597.90
|
|
Discover 4-(2,6-Dichlorobenzyloxy)benzaldehyde by Aladdin Scientific in for only $597.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 4-[(2,6-dichlorobenzyl)oxy]benzaldehyde | 166049-76-9 | 4-[(2,6-dichlorophenyl)methoxy]benzaldehyde | 4-((2,6-Dichlorobenzyl)oxy)benzaldehyde | MFCD03422465 | 4-(2,6-dichlorobenzyloxy)benzaldehyde | SCHEMBL6602394 | DTXSID70352780 | HUSGNWQDBYHKLU-UHFFFAOYSA-N | BBL016397 | |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Chlorobenzenes |
| Direct Parent | Dichlorobenzenes |
| Alternative Parents | Phenoxy compounds Phenol ethers Benzoyl derivatives Benzaldehydes Alkyl aryl ethers Aryl chlorides Organochlorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxy compound - Benzaldehyde - Benzoyl - Phenol ether - 1,3-dichlorobenzene - Alkyl aryl ether - Aryl-aldehyde - Aryl chloride - Aryl halide - Ether - Organooxygen compound - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Aldehyde - Organohalogen compound - Organochloride - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as dichlorobenzenes. These are compounds containing a benzene with exactly two chlorine atoms attached to it. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-[(2,6-dichlorophenyl)methoxy]benzaldehyde |
|---|---|
| INCHI | InChI=1S/C14H10Cl2O2/c15-13-2-1-3-14(16)12(13)9-18-11-6-4-10(8-17)5-7-11/h1-8H,9H2 |
| InChIKey | HUSGNWQDBYHKLU-UHFFFAOYSA-N |
| Smiles | C1=CC(=C(C(=C1)Cl)COC2=CC=C(C=C2)C=O)Cl |
| Isomeric SMILES | C1=CC(=C(C(=C1)Cl)COC2=CC=C(C=C2)C=O)Cl |
| Molecular Weight | 281.13 |
| Reaxy-Rn | 7296300 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=7296300&ln= |
| Molecular Weight | 281.100 g/mol |
|---|---|
| XLogP3 | 4.100 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 4 |
| Exact Mass | 280.006 Da |
| Monoisotopic Mass | 280.006 Da |
| Topological Polar Surface Area | 26.300 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 255.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |