Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B301172-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$69.90
|
|
Discover 4-[(2,4-difluorophenyl)methyl]piperidine by Aladdin Scientific in ≧95% for only $69.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 4-(2,4-Difluorobenzyl)piperidine | 203860-02-0 | 4-[(2,4-Difluorophenyl)methyl]piperidine | 4-(2,4-difluoro-benzyl)-piperidine | Piperidine, 4-[(2,4-difluorophenyl)methyl]- | SCHEMBL1322888 | DTXSID60594915 | VXQMAHFHVBQZHC-UHFFFAOYSA-N | AKOS012095742 | CS-0269269 | C78031 | |
|---|---|
| Specifications & Purity | ≥95% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Piperidines |
| Subclass | Benzylpiperidines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 4-benzylpiperidines |
| Alternative Parents | Fluorobenzenes Aralkylamines Aryl fluorides Dialkylamines Azacyclic compounds Organofluorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 4-benzylpiperidine - Fluorobenzene - Halobenzene - Aralkylamine - Aryl fluoride - Aryl halide - Monocyclic benzene moiety - Benzenoid - Secondary aliphatic amine - Secondary amine - Azacycle - Organofluoride - Organohalogen compound - Hydrocarbon derivative - Organic nitrogen compound - Amine - Organonitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 4-benzylpiperidines. These are organic compounds containing a benzyl group attached to the 4-position of a piperidine. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-[(2,4-difluorophenyl)methyl]piperidine |
|---|---|
| INCHI | InChI=1S/C12H15F2N/c13-11-2-1-10(12(14)8-11)7-9-3-5-15-6-4-9/h1-2,8-9,15H,3-7H2 |
| InChIKey | VXQMAHFHVBQZHC-UHFFFAOYSA-N |
| Smiles | C1CNCCC1CC2=C(C=C(C=C2)F)F |
| Isomeric SMILES | C1CNCCC1CC2=C(C=C(C=C2)F)F |
| Molecular Weight | 211.25 |
| Reaxy-Rn | 11322482 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=11322482&ln= |
| Molecular Weight | 211.250 g/mol |
|---|---|
| XLogP3 | 2.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 211.117 Da |
| Monoisotopic Mass | 211.117 Da |
| Topological Polar Surface Area | 12.000 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 192.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |