Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D303853-250mg
|
250mg |
3
|
$41.90
|
|
|
D303853-1g
|
1g |
3
|
$109.90
|
|
|
D303853-5g
|
5g |
3
|
$380.90
|
|
| Synonyms | 4-(1H-TETRAZOL-5-YL)PHENOL | 51517-88-5 | 5-(4-Hydroxyphenyl)tetrazole | 4-(2h-tetrazol-5-yl)phenol | MFCD05662709 | 5-(4-hydroxyphenyl)-1H-tetrazole | Phenol, 4-(1H-tetrazol-5-yl)- | NoName_229 | SCHEMBL595369 | CHEMBL289030 | YSCH0310 | DTXSID50901154 | DTXSID90419945 | QOYMNYWF |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azoles |
| Subclass | Tetrazoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenyltetrazoles and derivatives |
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids Benzene and substituted derivatives Heteroaromatic compounds Azacyclic compounds Organooxygen compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Phenyltetrazole - 1-hydroxy-2-unsubstituted benzenoid - Phenol - Benzenoid - Monocyclic benzene moiety - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Organic oxygen compound - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenyltetrazoles and derivatives. These are compounds containing a phenyltetrazole skeleton, which consists of a tetrazole bound to a phenyl group. |
| External Descriptors | Not available |
|
|
|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| Pubchem Sid | 504760295 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504760295 |
| IUPAC Name | 4-(2H-tetrazol-5-yl)phenol |
| INCHI | InChI=1S/C7H6N4O/c12-6-3-1-5(2-4-6)7-8-10-11-9-7/h1-4,12H,(H,8,9,10,11) |
| InChIKey | QOYMNYWFHZFXHR-UHFFFAOYSA-N |
| Smiles | C1=CC(=CC=C1C2=NNN=N2)O |
| Isomeric SMILES | C1=CC(=CC=C1C2=NNN=N2)O |
| Molecular Weight | 162.15 |
| Reaxy-Rn | 5332441 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=5332441&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | May 07, 2025 | D303853 | |
| Certificate of Analysis | May 07, 2025 | D303853 | |
| Certificate of Analysis | May 07, 2025 | D303853 |
| Melt Point(°C) | 240°C |
|---|---|
| Molecular Weight | 162.150 g/mol |
| XLogP3 | 0.800 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 162.054 Da |
| Monoisotopic Mass | 162.054 Da |
| Topological Polar Surface Area | 74.700 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 146.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |