Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
P186299-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$54.90
|
|
|
P186299-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$715.90
|
|
| Synonyms | 7311-93-5 | 3-(Piperidin-1-ylsulfonyl)benzoic acid | 3-(Piperidine-1-sulfonyl)benzoic acid | 3-(Piperidinosulfonyl)benzenecarboxylic acid | 3-(Piperidine-1-sulfonyl)-benzoic acid | 3-piperidin-1-ylsulfonylbenzoic acid | MFCD00760901 | Benzoic acid,3-(1-piperidinylsulfo |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzenesulfonamides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzenesulfonamides |
| Alternative Parents | Benzoic acids Benzenesulfonyl compounds Benzoyl derivatives Piperidines Organosulfonamides Sulfonyls Monocarboxylic acids and derivatives Carboxylic acids Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Benzenesulfonamide - Benzoic acid or derivatives - Benzoic acid - Benzenesulfonyl group - Benzoyl - Piperidine - Organosulfonic acid amide - Organic sulfonic acid or derivatives - Organosulfonic acid or derivatives - Sulfonyl - Carboxylic acid derivative - Carboxylic acid - Monocarboxylic acid or derivatives - Azacycle - Organoheterocyclic compound - Organonitrogen compound - Organic oxygen compound - Organic nitrogen compound - Organooxygen compound - Organosulfur compound - Hydrocarbon derivative - Organopnictogen compound - Organic oxide - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzenesulfonamides. These are organic compounds containing a sulfonamide group that is S-linked to a benzene ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 3-piperidin-1-ylsulfonylbenzoic acid |
|---|---|
| INCHI | InChI=1S/C12H15NO4S/c14-12(15)10-5-4-6-11(9-10)18(16,17)13-7-2-1-3-8-13/h4-6,9H,1-3,7-8H2,(H,14,15) |
| InChIKey | QRFCJPBEPZZXEE-UHFFFAOYSA-N |
| Smiles | C1CCN(CC1)S(=O)(=O)C2=CC=CC(=C2)C(=O)O |
| Isomeric SMILES | C1CCN(CC1)S(=O)(=O)C2=CC=CC(=C2)C(=O)O |
| PubChem CID | 767889 |
| Molecular Weight | 269.3 |
| Molecular Weight | 269.320 g/mol |
|---|---|
| XLogP3 | 1.400 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 3 |
| Exact Mass | 269.072 Da |
| Monoisotopic Mass | 269.072 Da |
| Topological Polar Surface Area | 83.100 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 395.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |