Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
O177028-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$144.90
|
|
Discover 3-oxocyclobutyl acetate by Aladdin Scientific in 97% for only $144.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 3-OXOCYCLOBUTYL ACETATE | 63930-59-6 | (3-oxocyclobutyl) Acetate | MFCD11976057 | 3-Acetoxycyclobutanone | 3-OXOCYCLOBUTYLACETATE | SCHEMBL1795613 | DTXSID70472598 | FWHLIVHQAGFBOA-UHFFFAOYSA-N | AKOS016000412 | DS-5418 | PB31624 | SY025795 | CS-0045537 | FT-0686174 | A867986 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Carboxylic acid derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Carboxylic acid esters |
| Alternative Parents | Cyclic ketones Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Cyclic ketone - Ketone - Carboxylic acid ester - Monocarboxylic acid or derivatives - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as carboxylic acid esters. These are carboxylic acid derivatives in which the carbon atom from the carbonyl group is attached to an alkyl or an aryl moiety through an oxygen atom (forming an ester group). |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (3-oxocyclobutyl) acetate |
|---|---|
| INCHI | InChI=1S/C6H8O3/c1-4(7)9-6-2-5(8)3-6/h6H,2-3H2,1H3 |
| InChIKey | FWHLIVHQAGFBOA-UHFFFAOYSA-N |
| Smiles | CC(=O)OC1CC(=O)C1 |
| Isomeric SMILES | CC(=O)OC1CC(=O)C1 |
| Molecular Weight | 128.127 |
| Reaxy-Rn | 2515602 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2515602&ln= |
| Molecular Weight | 128.130 g/mol |
|---|---|
| XLogP3 | -0.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 128.047 Da |
| Monoisotopic Mass | 128.047 Da |
| Topological Polar Surface Area | 43.400 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 142.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |