Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M173818-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,534.90
|
|
Discover 3-methyl-1H,4H,5H,6H-pyrrolo[3,4-c]pyrazole dihydrochloride by Aladdin Scientific in 97% for only $2,534.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 1389264-31-6 | 3-Methyl-1,4,5,6-tetrahydropyrrolo[3,4-c]pyrazole hydrochloride | 3-methyl-2,4,5,6-tetrahydropyrrolo[3,4-c]pyrazole;hydrochloride | 3-Methyl-1,4,5,6-tetrahydropyrrolo-[3,4-c]pyrazole hydrochloride | SCHEMBL16060011 | BS-41638 | CS-0051280 | W19431 | 3-Meth |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyrrolopyrazoles |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrrolopyrazoles |
| Alternative Parents | Aralkylamines Pyrroles Pyrazoles Heteroaromatic compounds Dialkylamines Azacyclic compounds Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Pyrrolopyrazole - Aralkylamine - Heteroaromatic compound - Pyrrole - Pyrazole - Azole - Azacycle - Secondary amine - Secondary aliphatic amine - Organic nitrogen compound - Hydrocarbon derivative - Hydrochloride - Organonitrogen compound - Amine - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrrolopyrazoles. These are polycyclic aromatic compounds containing a pyrrole fused to a pyrazole ring. Pyrrole is 5-membered ring consisting of four carbon atoms and one nitrogen atom. Pyrazole is a 5-membered ring consisting of three carbon atoms and two adjacent nitrogen centers. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 3-methyl-2,4,5,6-tetrahydropyrrolo[3,4-c]pyrazole;hydrochloride |
|---|---|
| INCHI | InChI=1S/C6H9N3.ClH/c1-4-5-2-7-3-6(5)9-8-4;/h7H,2-3H2,1H3,(H,8,9);1H |
| InChIKey | JYYAGGWXWLOABC-UHFFFAOYSA-N |
| Smiles | CC1=C2CNCC2=NN1.Cl |
| Isomeric SMILES | CC1=C2CNCC2=NN1.Cl |
| PubChem CID | 73977855 |
| Molecular Weight | 196.08 |
| Molecular Weight | 159.620 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 159.056 Da |
| Monoisotopic Mass | 159.056 Da |
| Topological Polar Surface Area | 40.700 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 115.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |