Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M176584-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$322.90
|
|
Discover 3-methoxycyclobutane-1-carboxylic acid by Aladdin Scientific in 97% for only $322.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 3-METHOXYCYCLOBUTANECARBOXYLIC ACID | 480450-03-1 | CIS-3-METHOXYCYCLOBUTANECARBOXYLIC ACID | TRANS-3-METHOXYCYCLOBUTANECARBOXYLIC ACID | 552849-35-1 | 1408076-05-0 | 3-METHOXYCYCLOBUTANE-1-CARBOXYLIC ACID | MFCD08705860 | MFCD22396943 | MFCD22396944 | Cyclobutanecarboxylic |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Carboxylic acids |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Carboxylic acids |
| Alternative Parents | Monocarboxylic acids and derivatives Dialkyl ethers Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Monocarboxylic acid or derivatives - Ether - Dialkyl ether - Carboxylic acid - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as carboxylic acids. These are compounds containing a carboxylic acid group with the formula -C(=O)OH. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 3-methoxycyclobutane-1-carboxylic acid |
|---|---|
| INCHI | InChI=1S/C6H10O3/c1-9-5-2-4(3-5)6(7)8/h4-5H,2-3H2,1H3,(H,7,8) |
| InChIKey | PRADZEMZRCCINO-UHFFFAOYSA-N |
| Smiles | COC1CC(C1)C(=O)O |
| Isomeric SMILES | COC1CC(C1)C(=O)O |
| Molecular Weight | 130.143 |
| Reaxy-Rn | 11407443 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=11407443&ln= |
| Molecular Weight | 130.139 g/mol |
|---|---|
| XLogP3 | 0.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 130.063 Da |
| Monoisotopic Mass | 130.063 Da |
| Topological Polar Surface Area | 46.500 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 115.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |