Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D120559-1g
|
1g |
3
|
$89.90
|
|
|
D120559-5g
|
5g |
1
|
$317.90
|
|
| Synonyms | DTXSID70660579 | 3-DIMETHYLAMINOPHENYLBORONIC ACID HYDROCHLORIDE | (3-(Dimethylamino)phenyl)boronic acid hydrochloride | [3-(Dimethylamino)phenyl]boronic acid--hydrogen chloride (1/1) | Alkamide L-203 | EN300-7370257 | AMY7914 | DS-0838 | AKOS015846407 | |
|---|---|
| Specifications & Purity | ≥98% |
| Shipped In | Normal |
| Product Description |
contains varying amounts of Anhydride |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Amines |
| Intermediate Tree Nodes | Tertiary amines - Tertiary alkylarylamines |
| Direct Parent | Dialkylarylamines |
| Alternative Parents | Aniline and substituted anilines Boronic acids Organic metalloid salts Organometalloid compounds Organic oxygen compounds Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Aniline or substituted anilines - Dialkylarylamine - Benzenoid - Monocyclic benzene moiety - Boronic acid - Boronic acid derivative - Organic metalloid salt - Organic oxygen compound - Hydrocarbon derivative - Hydrochloride - Organic metalloid moeity - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as dialkylarylamines. These are aliphatic aromatic amines in which the amino group is linked to two aliphatic chains and one aromatic group. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504770473 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504770473 |
| IUPAC Name | [3-(dimethylamino)phenyl]boronic acid;hydrochloride |
| INCHI | InChI=1S/C8H12BNO2.ClH/c1-10(2)8-5-3-4-7(6-8)9(11)12;/h3-6,11-12H,1-2H3;1H |
| InChIKey | QDYZZIRCCVRLBI-UHFFFAOYSA-N |
| Smiles | B(C1=CC(=CC=C1)N(C)C)(O)O.Cl |
| Isomeric SMILES | B(C1=CC(=CC=C1)N(C)C)(O)O.Cl |
| Molecular Weight | 201.46 |
| Reaxy-Rn | 45304622 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=45304622&ln= |
| Solubility | Soluble in water |
|---|---|
| Sensitivity | Hygroscopic |
| Molecular Weight | 201.460 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 201.073 Da |
| Monoisotopic Mass | 201.073 Da |
| Topological Polar Surface Area | 43.700 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 141.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |