Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C480370-1g
|
1g |
3
|
$167.90
|
|
| Synonyms | 3-Chloro-4-nitropyridine 1-oxide | AF-807/00321041 | 3-Chloro-4-nitropyridine-N-oxide | DTXSID00344830 | J-512250 | 3-chloro-4-nitro-1-oxidopyridin-1-ium | PB25999 | MBHLTDWOVIYXEW-UHFFFAOYSA-N | 3-CHLORO-4-NITROPYRIDINE N-OXIDE | FT-0730018 | SCHEMBL3059 |
|---|---|
| Specifications & Purity | ≥98% |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic 1,3-dipolar compounds |
| Class | Allyl-type 1,3-dipolar organic compounds |
| Subclass | Organic nitro compounds |
| Intermediate Tree Nodes | C-nitro compounds |
| Direct Parent | Nitroaromatic compounds |
| Alternative Parents | Pyridinium derivatives Aryl chlorides Heteroaromatic compounds Propargyl-type 1,3-dipolar organic compounds Organic oxoazanium compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organochlorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Nitroaromatic compound - Aryl chloride - Aryl halide - Pyridine - Pyridinium - Heteroaromatic compound - Organic oxoazanium - Propargyl-type 1,3-dipolar organic compound - Organoheterocyclic compound - Azacycle - Organic oxide - Organopnictogen compound - Organonitrogen compound - Organochloride - Organic nitrogen compound - Organic oxygen compound - Organohalogen compound - Hydrocarbon derivative - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as nitroaromatic compounds. These are c-nitro compounds where the nitro group is C-substituted with an aromatic group. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504759459 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504759459 |
| IUPAC Name | 3-chloro-4-nitro-1-oxidopyridin-1-ium |
| INCHI | InChI=1S/C5H3ClN2O3/c6-4-3-7(9)2-1-5(4)8(10)11/h1-3H |
| InChIKey | MBHLTDWOVIYXEW-UHFFFAOYSA-N |
| Smiles | C1=C[N+](=CC(=C1[N+](=O)[O-])Cl)[O-] |
| Isomeric SMILES | C1=C[N+](=CC(=C1[N+](=O)[O-])Cl)[O-] |
| Molecular Weight | 174.54 |
| Reaxy-Rn | 1426560 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1426560&ln= |
| Molecular Weight | 174.540 g/mol |
|---|---|
| XLogP3 | 0.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 173.983 Da |
| Monoisotopic Mass | 173.983 Da |
| Topological Polar Surface Area | 71.300 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 160.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |