Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C169482-50ml
|
50ml |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$237.90
|
|
Discover 3-Chloro-4-fluorophenylzinc iodide solution by Aladdin Scientific in for only $237.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 3-Chloro-4-fluorophenylzinc iodide | MFCD01311396 | AKOS016017882 | 1-chloro-2-fluorobenzene-5-ide;iodozinc(1+) | 3-CHLORO-4-FLUOROPHENYLZINCIODIDE | 3-Chloro-4-fluorophenylzinc iodide, 0.5M in THF | (3-chloro-4-fluorophenyl)zinc(II) iodide | (3-Chloro-4- |
|---|---|
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fluorobenzenes |
| Alternative Parents | Chlorobenzenes Aryl fluorides Aryl chlorides Organic transition metal salts Organic metal halides Organofluorides Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Fluorobenzene - Chlorobenzene - Aryl halide - Aryl fluoride - Aryl chloride - Organic metal halide - Organic metal salt - Organic transition metal salt - Hydrocarbon derivative - Organic salt - Organofluoride - Organochloride - Organohalogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as fluorobenzenes. These are compounds containing one or more fluorine atoms attached to a benzene ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1-chloro-2-fluorobenzene-5-ide;iodozinc(1+) |
|---|---|
| INCHI | InChI=1S/C6H3ClF.HI.Zn/c7-5-3-1-2-4-6(5)8;;/h2-4H;1H;/q-1;;+2/p-1 |
| InChIKey | XHCKYSVZNOHHHD-UHFFFAOYSA-M |
| Smiles | C1=CC(=C(C=[C-]1)Cl)F.[Zn+]I |
| Isomeric SMILES | C1=CC(=C(C=[C-]1)Cl)F.[Zn+]I |
| WGK Germany | 3 |
| PubChem CID | 2778326 |
| Molecular Weight | 321.83 |
| Flash Point(°F) | 1.4 °F |
|---|---|
| Flash Point(°C) | -17 °C |
| Molecular Weight | 321.800 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 319.824 Da |
| Monoisotopic Mass | 319.824 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 186.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |