Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C183245-1g
|
1g |
2
|
$36.90
|
|
|
C183245-5g
|
5g |
2
|
$123.90
|
|
| Synonyms | 3-Chloro-2,6-difluorophenol | 261762-51-0 | Phenol, 3-chloro-2,6-difluoro- | 3-chloranyl-2,6-bis(fluoranyl)phenol | 3-CHLORO-2,6-DIFLUOROPHENOL97 | SCHEMBL739256 | DTXSID20378556 | CCLYWHXHYLQWQK-UHFFFAOYSA-N | 3-Chloro-2,6-difluorophenol 97 | MFCD01631330 | AKOS006229371 | PS |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenols |
| Subclass | Halophenols |
| Intermediate Tree Nodes | Fluorophenols |
| Direct Parent | O-fluorophenols |
| Alternative Parents | M-chlorophenols Fluorobenzenes Chlorobenzenes 1-hydroxy-4-unsubstituted benzenoids Aryl fluorides Aryl chlorides Organooxygen compounds Organofluorides Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | 3-chlorophenol - 2-fluorophenol - 1-hydroxy-4-unsubstituted benzenoid - Chlorobenzene - Fluorobenzene - Halobenzene - Aryl chloride - Aryl fluoride - Aryl halide - Monocyclic benzene moiety - Hydrocarbon derivative - Organic oxygen compound - Organooxygen compound - Organofluoride - Organochloride - Organohalogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as o-fluorophenols. These are fluorophenols carrying a iodine at the C2 position of the benzene ring. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488193515 |
|---|---|
| IUPAC Name | 3-chloro-2,6-difluorophenol |
| INCHI | InChI=1S/C6H3ClF2O/c7-3-1-2-4(8)6(10)5(3)9/h1-2,10H |
| InChIKey | CCLYWHXHYLQWQK-UHFFFAOYSA-N |
| Smiles | C1=CC(=C(C(=C1F)O)F)Cl |
| Isomeric SMILES | C1=CC(=C(C(=C1F)O)F)Cl |
| Molecular Weight | 164.5 |
| Reaxy-Rn | 18876786 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=18876786&ln= |
| Molecular Weight | 164.540 g/mol |
|---|---|
| XLogP3 | 2.400 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 163.984 Da |
| Monoisotopic Mass | 163.984 Da |
| Topological Polar Surface Area | 20.200 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 122.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |