Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B168593-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$66.90
|
|
| Synonyms | tert-Butyl (2-bromothiophen-3-yl)carbamate | 21483-64-7 | 3-(BOC-AMINO)-2-BROMOTHIOPHENE | tert-butyl N-(2-bromothiophen-3-yl)carbamate | SCHEMBL437283 | DTXSID20524071 | UCPJQSLSJLTVND-UHFFFAOYSA-N | WAA48364 | MFCD01927222 | AKOS023846777 | tert-Butyl 2-bromothien-3-ylcarb |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organohalogen compounds |
| Class | Aryl halides |
| Subclass | Aryl bromides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aryl bromides |
| Alternative Parents | Thiophenes Heteroaromatic compounds Carbamate esters Organonitrogen compounds Organobromides Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Aryl bromide - Heteroaromatic compound - Carbamic acid ester - Thiophene - Organoheterocyclic compound - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organobromide - Carbonyl group - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aryl bromides. These are organic compounds containing the acyl bromide functional group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | tert-butyl N-(2-bromothiophen-3-yl)carbamate |
|---|---|
| INCHI | InChI=1S/C9H12BrNO2S/c1-9(2,3)13-8(12)11-6-4-5-14-7(6)10/h4-5H,1-3H3,(H,11,12) |
| InChIKey | UCPJQSLSJLTVND-UHFFFAOYSA-N |
| Smiles | CC(C)(C)OC(=O)NC1=C(SC=C1)Br |
| Isomeric SMILES | CC(C)(C)OC(=O)NC1=C(SC=C1)Br |
| WGK Germany | 3 |
| Molecular Weight | 278.17 |
| Reaxy-Rn | 1372135 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1372135&ln= |
| Molecular Weight | 278.170 g/mol |
|---|---|
| XLogP3 | 3.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 276.977 Da |
| Monoisotopic Mass | 276.977 Da |
| Topological Polar Surface Area | 66.600 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 217.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |