Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B177933-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$3,036.90
|
|
Discover 3-boc-3,7-diazabicyclo[4.2.0]octane by Aladdin Scientific in 97% for only $3,036.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 885271-67-0 | 3-Boc-3,7-diazabicyclo[4.2.0]octane | tert-butyl 3,7-diazabicyclo[4.2.0]octane-3-carboxylate | MFCD08234914 | 1250993-51-1 | MFCD18384926 | MFCD21332889 | SCHEMBL21801914 | DTXSID80656408 | AKOS015840956 | PB13824 | PB18855 | SB20146 | SB20147 | AM804484 | AS-41933 | SY016 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Piperidines |
| Subclass | Piperidinecarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Piperidinecarboxylic acids |
| Alternative Parents | Carbamate esters Tertiary amines Azetidines Dialkylamines Azacyclic compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Substituents | Piperidinecarboxylic acid - Carbamic acid ester - Azetidine - Tertiary amine - Secondary aliphatic amine - Secondary amine - Azacycle - Amine - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Carbonyl group - Organic oxide - Hydrocarbon derivative - Organic nitrogen compound - Aliphatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as piperidinecarboxylic acids. These are compounds containing a piperidine ring which bears a carboxylic acid group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | tert-butyl 3,7-diazabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| INCHI | InChI=1S/C11H20N2O2/c1-11(2,3)15-10(14)13-5-4-9-8(7-13)6-12-9/h8-9,12H,4-7H2,1-3H3 |
| InChIKey | TUIAJQPTVCSWOB-UHFFFAOYSA-N |
| Smiles | CC(C)(C)OC(=O)N1CCC2C(C1)CN2 |
| Isomeric SMILES | CC(C)(C)OC(=O)N1CCC2C(C1)CN2 |
| Molecular Weight | 212.293 |
| Reaxy-Rn | 37998268 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=37998268&ln= |
| Molecular Weight | 212.290 g/mol |
|---|---|
| XLogP3 | 0.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 212.152 Da |
| Monoisotopic Mass | 212.152 Da |
| Topological Polar Surface Area | 41.600 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 260.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |