Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B168143-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$920.90
|
|
| Synonyms | 3-(benzyloxy)-2-thiophenecarboxylic acid | 186588-88-5 | 3-(benzyloxy)thiophene-2-carboxylic acid | 3-phenylmethoxythiophene-2-carboxylic acid | Bionet2_000036 | Oprea1_481617 | MLS000755460 | SCHEMBL4096759 | CHEMBL1488692 | DTXSID90377596 | HUEDDFOWAJIHBA-UHFFFAOYSA-N | HMS1 |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Thiophenes |
| Subclass | Thiophene carboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Thiophene carboxylic acids |
| Alternative Parents | Alkyl aryl ethers Benzene and substituted derivatives Heteroaromatic compounds Monocarboxylic acids and derivatives Carboxylic acids Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Thiophene carboxylic acid - Alkyl aryl ether - Benzenoid - Monocyclic benzene moiety - Heteroaromatic compound - Monocarboxylic acid or derivatives - Ether - Carboxylic acid - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as thiophene carboxylic acids. These are compounds containing a thiophene ring which bears a carboxylic acid group. |
| External Descriptors | Not available |
|
|
|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | 3-phenylmethoxythiophene-2-carboxylic acid |
|---|---|
| INCHI | InChI=1S/C12H10O3S/c13-12(14)11-10(6-7-16-11)15-8-9-4-2-1-3-5-9/h1-7H,8H2,(H,13,14) |
| InChIKey | HUEDDFOWAJIHBA-UHFFFAOYSA-N |
| Smiles | C1=CC=C(C=C1)COC2=C(SC=C2)C(=O)O |
| Isomeric SMILES | C1=CC=C(C=C1)COC2=C(SC=C2)C(=O)O |
| Molecular Weight | 234.27 |
| Reaxy-Rn | 8392689 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=8392689&ln= |
| Molecular Weight | 234.270 g/mol |
|---|---|
| XLogP3 | 2.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 4 |
| Exact Mass | 234.035 Da |
| Monoisotopic Mass | 234.035 Da |
| Topological Polar Surface Area | 74.800 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 238.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |