Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C184547-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,584.90
|
|
| Synonyms | 439110-86-8 | 3-(6-chloroimidazo[1,2-a]pyridin-2-yl)aniline | 3-(6-CHLORO-IMIDAZO[1,2-A]PYRIDIN-2-YL)-PHENYLAMINE | 3-(6-Chloro-imidazo[1,2-a]pyridin-2-yl)phenylamine | 3-{6-chloroimidazo[1,2-a]pyridin-2-yl}aniline | SCHEMBL6481319 | DTXSID90363196 | MFCD03012831 | AKOS0 |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azoles |
| Subclass | Imidazoles |
| Intermediate Tree Nodes | Substituted imidazoles |
| Direct Parent | Phenylimidazoles |
| Alternative Parents | Imidazopyridines Imidazo[1,2-a]pyridines Aniline and substituted anilines Pyridines and derivatives N-substituted imidazoles Aryl chlorides Heteroaromatic compounds Azacyclic compounds Primary amines Organopnictogen compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | 5-phenylimidazole - 4-phenylimidazole - Imidazopyridine - Imidazo[1,2-a]pyridine - Aniline or substituted anilines - Aryl chloride - Aryl halide - Monocyclic benzene moiety - N-substituted imidazole - Pyridine - Benzenoid - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Hydrocarbon derivative - Organopnictogen compound - Primary amine - Amine - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylimidazoles. These are polycyclic aromatic compounds containing a benzene ring linked to an imidazole ring through a CC or CN bond. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 3-(6-chloroimidazo[1,2-a]pyridin-2-yl)aniline |
|---|---|
| INCHI | InChI=1S/C13H10ClN3/c14-10-4-5-13-16-12(8-17(13)7-10)9-2-1-3-11(15)6-9/h1-8H,15H2 |
| InChIKey | DGRUBXTUPVOPAI-UHFFFAOYSA-N |
| Smiles | C1=CC(=CC(=C1)N)C2=CN3C=C(C=CC3=N2)Cl |
| Isomeric SMILES | C1=CC(=CC(=C1)N)C2=CN3C=C(C=CC3=N2)Cl |
| Molecular Weight | 243.7 |
| Reaxy-Rn | 11428189 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=11428189&ln= |
| Molecular Weight | 243.690 g/mol |
|---|---|
| XLogP3 | 3.400 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 243.056 Da |
| Monoisotopic Mass | 243.056 Da |
| Topological Polar Surface Area | 43.300 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 273.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |