Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D102566-1g
|
1g |
3
|
$42.90
|
|
|
D102566-5g
|
5g |
5
|
$138.90
|
|
|
D102566-25g
|
25g |
4
|
$584.90
|
|
|
D102566-100g
|
100g |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$1,854.90
|
|
| Synonyms | 3,5-Dimethylphenylhydrazine hydrochloride | 60481-36-9 | (3,5-dimethylphenyl)hydrazine hydrochloride | 3,5-Dimethylphenylhydrazine, HCl | (3,5-dimethylphenyl)hydrazine;hydrochloride | 3,5-Dimethylphenylhydrazine HCl | MFCD00052269 | Hydrazine, (3,5-dimethylphenyl)-, mo |
|---|---|
| Specifications & Purity | ≥98% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Phenylhydrazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylhydrazines |
| Alternative Parents | m-Xylenes Organopnictogen compounds Organonitrogen compounds Organic chloride salts Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | M-xylene - Xylene - Phenylhydrazine - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organic chloride salt - Organic salt - Organonitrogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylhydrazines. These are compounds containing a phenylhydrazide moiety, which consists of a hydrazide substituent attached to a phenyl group. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488198206 |
|---|---|
| IUPAC Name | (3,5-dimethylphenyl)hydrazine;hydrochloride |
| INCHI | InChI=1S/C8H12N2.ClH/c1-6-3-7(2)5-8(4-6)10-9;/h3-5,10H,9H2,1-2H3;1H |
| InChIKey | RSBQANBNDXZFIY-UHFFFAOYSA-N |
| Smiles | CC1=CC(=CC(=C1)NN)C.Cl |
| Isomeric SMILES | CC1=CC(=CC(=C1)NN)C.Cl |
| Molecular Weight | 172.66 |
| Reaxy-Rn | 4544208 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=4544208&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Aug 04, 2023 | D102566 | |
| Certificate of Analysis | Jun 30, 2023 | D102566 | |
| Certificate of Analysis | Jun 28, 2023 | D102566 | |
| Certificate of Analysis | Feb 09, 2022 | D102566 |
| Solubility | Soluble in water. |
|---|---|
| Melt Point(°C) | 180°C |
| Molecular Weight | 172.650 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 172.077 Da |
| Monoisotopic Mass | 172.077 Da |
| Topological Polar Surface Area | 38.100 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 93.400 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |