Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B301109-1g
|
1g |
5
|
$103.90
|
|
|
B301109-5g
|
5g |
2
|
$330.90
|
|
|
B301109-25g
|
25g |
1
|
$1,133.90
|
|
| Synonyms | 3,5-Dimethoxyphenyl isothiocyanate | 104968-58-3 | 1-Isothiocyanato-3,5-dimethoxybenzene | Benzene,1-isothiocyanato-3,5-dimethoxy- | MFCD00041077 | 1-isothiocyanato-3,5-dimethoxy-benzene | SCHEMBL1021008 | 3,5 dimethoxyphenylisothiocyanate | 3,5-dimethoxyphenylisothiocya |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Argon charged |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Methoxybenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Dimethoxybenzenes |
| Alternative Parents | Methoxyanilines Phenoxy compounds Anisoles Alkyl aryl ethers Isothiocyanates Propargyl-type 1,3-dipolar organic compounds Organopnictogen compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | M-dimethoxybenzene - Dimethoxybenzene - Methoxyaniline - Phenoxy compound - Anisole - Phenol ether - Alkyl aryl ether - Isothiocyanate - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Ether - Organopnictogen compound - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Organic oxygen compound - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as dimethoxybenzenes. These are organic aromatic compounds containing a monocyclic benzene moiety carrying exactly two methoxy groups. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488188184 |
|---|---|
| IUPAC Name | 1-isothiocyanato-3,5-dimethoxybenzene |
| INCHI | InChI=1S/C9H9NO2S/c1-11-8-3-7(10-6-13)4-9(5-8)12-2/h3-5H,1-2H3 |
| InChIKey | FKUHOOASBHTEQY-UHFFFAOYSA-N |
| Smiles | COC1=CC(=CC(=C1)N=C=S)OC |
| Isomeric SMILES | COC1=CC(=CC(=C1)N=C=S)OC |
| Molecular Weight | 195.24 |
| Beilstein | 3258656 |
| Reaxy-Rn | 3258656 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3258656&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Sep 01, 2023 | B301109 | |
| Certificate of Analysis | Sep 01, 2023 | B301109 | |
| Certificate of Analysis | Sep 01, 2023 | B301109 | |
| Certificate of Analysis | Sep 01, 2023 | B301109 | |
| Certificate of Analysis | Sep 01, 2023 | B301109 | |
| Certificate of Analysis | Sep 01, 2023 | B301109 | |
| Certificate of Analysis | Feb 25, 2023 | B301109 | |
| Certificate of Analysis | Feb 25, 2023 | B301109 | |
| Certificate of Analysis | Feb 25, 2023 | B301109 |
| Sensitivity | Moisture sensitive |
|---|---|
| Boil Point(°C) | 130-132°/3mm Hg |
| Melt Point(°C) | 49-52℃ |
| Molecular Weight | 195.240 g/mol |
| XLogP3 | 3.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 195.035 Da |
| Monoisotopic Mass | 195.035 Da |
| Topological Polar Surface Area | 62.900 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 192.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |