Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D178880-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$997.90
|
|
| Synonyms | 1029716-94-6 | 4-Borono-2,6-difluorobenzoic acid | 3,5-Difluoro-4-carboxyphenylboronic acid | MFCD13181636 | 4-Borono-2,6-difluorobenzoicacid | 4-BORONO-2,6-DIFLUORO-BENZOIC ACID | 4-(DIHYDROXYBORANYL)-2,6-DIFLUOROBENZOIC ACID | SCHEMBL1953511 | DTXSID40726919 | AKOS016014 |
|---|---|
| Specifications & Purity | ≥96% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzoic acids and derivatives |
| Intermediate Tree Nodes | Halobenzoic acids and derivatives |
| Direct Parent | Halobenzoic acids |
| Alternative Parents | 2-halobenzoic acids Benzoic acids Benzoyl derivatives 1-carboxy-2-haloaromatic compounds Fluorobenzenes Aryl fluorides Vinylogous halides Boronic acids Organic metalloid salts Organooxygen compounds Organometalloid compounds Organofluorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Halobenzoic acid - 2-halobenzoic acid - 2-halobenzoic acid or derivatives - Benzoic acid - Benzoyl - 1-carboxy-2-haloaromatic compound - Fluorobenzene - Halobenzene - Aryl fluoride - Aryl halide - Vinylogous halide - Boronic acid derivative - Boronic acid - Carboxylic acid - Carboxylic acid derivative - Organic metalloid salt - Organofluoride - Organooxygen compound - Organic oxygen compound - Hydrocarbon derivative - Organic oxide - Organohalogen compound - Organic metalloid moeity - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as halobenzoic acids. These are benzoic acids carrying a halogen atom on the benzene ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-borono-2,6-difluorobenzoic acid |
|---|---|
| INCHI | InChI=1S/C7H5BF2O4/c9-4-1-3(8(13)14)2-5(10)6(4)7(11)12/h1-2,13-14H,(H,11,12) |
| InChIKey | AWIXNRNZROUJQB-UHFFFAOYSA-N |
| Smiles | B(C1=CC(=C(C(=C1)F)C(=O)O)F)(O)O |
| Isomeric SMILES | B(C1=CC(=C(C(=C1)F)C(=O)O)F)(O)O |
| Molecular Weight | 201.9 |
| Reaxy-Rn | 21169758 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=21169758&ln= |
| Molecular Weight | 201.920 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 2 |
| Exact Mass | 202.025 Da |
| Monoisotopic Mass | 202.025 Da |
| Topological Polar Surface Area | 77.800 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 214.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |