Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D186496-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$4,653.90
|
|
Discover 3,5-Difluoro-2-tributylstannylpyridine by Aladdin Scientific in 95% for only $4,653.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 3,5-Difluoro-2-tributylstannylpyridine | 765917-25-7 | 3,5-difluoro-2-(tributylstannyl)pyridine | tributyl-(3,5-difluoropyridin-2-yl)stannane | 2-(Tributylstannyl)-3,5-difluoropyridine | SCHEMBL2644102 | DTXSID80624162 | CFYNUOUCHUGXFE-UHFFFAOYSA-N | MFCD11109378 | AKOS015 |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Halopyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Polyhalopyridines |
| Alternative Parents | Metal aryls Aryl fluorides Heteroaromatic compounds Trialkyltins Azacyclic compounds Organonitrogen compounds Organofluorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Polyhalopyridine - Aryl fluoride - Metal aryl - Aryl halide - Heteroaromatic compound - Trialkyltin - Azacycle - Organic nitrogen compound - Organotin compound - Organonitrogen compound - Organometallic compound - Organofluoride - Organic post-transition metal moeity - Organohalogen compound - Hydrocarbon derivative - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as polyhalopyridines. These are organic compounds containing a pyridine ring substituted at two or more positions by a halogen atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | tributyl-(3,5-difluoropyridin-2-yl)stannane |
|---|---|
| INCHI | InChI=1S/C5H2F2N.3C4H9.Sn/c6-4-1-5(7)3-8-2-4;3*1-3-4-2;/h1-2H;3*1,3-4H2,2H3; |
| InChIKey | CFYNUOUCHUGXFE-UHFFFAOYSA-N |
| Smiles | CCCC[Sn](CCCC)(CCCC)C1=C(C=C(C=N1)F)F |
| Isomeric SMILES | CCCC[Sn](CCCC)(CCCC)C1=C(C=C(C=N1)F)F |
| Molecular Weight | 404.1 |
| Reaxy-Rn | 15575606 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=15575606&ln= |
| Molecular Weight | 404.100 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 10 |
| Exact Mass | 405.129 Da |
| Monoisotopic Mass | 405.129 Da |
| Topological Polar Surface Area | 12.900 Ų |
| Heavy Atom Count | 21 |
| Formal Charge | 0 |
| Complexity | 254.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |