Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
P160212-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$356.90
|
|
Discover 3-[2-(Perfluorohexyl)ethoxy]-1,2-epoxypropane by Aladdin Scientific in >96.0%(GC) for only $356.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 122193-68-4 | 3-[2-(Perfluorohexyl)ethoxy]-1,2-epoxypropane | 2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxymethyl)oxirane | 2S0WX1T1R9 | 3-(2-(perfluorohexyl)ethoxy)-1,2-epoxypropane | MF-120 | UNII-2S0WX1T1R9 | 1,2-Epoxy-4-oxa-6-perfluorohexylhexane | 2-(Perfluorohex |
|---|---|
| Specifications & Purity | ≥96%(GC) |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Epoxides |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Epoxides |
| Alternative Parents | Oxacyclic compounds Dialkyl ethers Organofluorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Oxacycle - Ether - Oxirane - Dialkyl ether - Organic oxygen compound - Hydrocarbon derivative - Organooxygen compound - Organofluoride - Organohalogen compound - Alkyl halide - Alkyl fluoride - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as epoxides. These are compounds containing a cyclic ether with three ring atoms(one oxygen and two carbon atoms). |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxymethyl)oxirane |
|---|---|
| INCHI | InChI=1S/C11H9F13O2/c12-6(13,1-2-25-3-5-4-26-5)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)24/h5H,1-4H2 |
| InChIKey | DRSDQADBHIDJCU-UHFFFAOYSA-N |
| Smiles | C1C(O1)COCCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| Isomeric SMILES | C1C(O1)COCCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| PubChem CID | 533993 |
| Molecular Weight | 420.17 |
| Molecular Weight | 420.170 g/mol |
|---|---|
| XLogP3 | 4.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 15 |
| Rotatable Bond Count | 9 |
| Exact Mass | 420.039 Da |
| Monoisotopic Mass | 420.039 Da |
| Topological Polar Surface Area | 21.800 Ų |
| Heavy Atom Count | 26 |
| Formal Charge | 0 |
| Complexity | 499.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Xin Bai, Jian Nie, Siyao Cheng, Daohu Sheng, Jijun Xiao, Wei Dong. (2025) Biocompatible fluorinated poly(2-hydroxypropenimine)s for safe and efficient gene transfection. COLLOIDS AND SURFACES A-PHYSICOCHEMICAL AND ENGINEERING ASPECTS, 705 (135575). |