Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T471243-25g
|
25g |
2
|
$108.90
|
|
|
T471243-100g
|
100g |
2
|
$257.90
|
|
| Synonyms | thiopene-2-carbonyl chloride | 2-Thiophenecarbonyl chloride, 97% | a-Thenoyl chloride | 2-Thiophenecarbonylchioride | EINECS 229-504-0 | 2-Thienylcarbonyl chloride | SCHEMBL1813 | DTXSID4063749 | Thiophenecarbonylchloride | 2-Thenoyl chloride | 2-Thiophen |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at 2-8°C,Protected from light,Argon charged |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
| Product Description |
The postfunctionalization reaction of 2-thiophenecarbonyl chloride with single walled carbon nanotubes (SWCNTs) was studied.2-Thiophenecarbonyl chloride was used in the synthesis of building blocks derived from ornithine by undergoing acylation/sulphonation of copper complex of orthinine. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Thiophenes |
| Subclass | Thiophene carboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Thiophene carboxylic acids and derivatives |
| Alternative Parents | Heteroaromatic compounds Acyl chlorides Organooxygen compounds Organochlorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Thiophene carboxylic acid or derivatives - Heteroaromatic compound - Acyl halide - Acyl chloride - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organochloride - Organohalogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as thiophene carboxylic acids and derivatives. These are compounds containing a thiophene ring which bears a carboxylic acid group (or a salt/ester thereof). |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | thiophene-2-carbonyl chloride |
|---|---|
| INCHI | InChI=1S/C5H3ClOS/c6-5(7)4-2-1-3-8-4/h1-3H |
| InChIKey | QIQITDHWZYEEPA-UHFFFAOYSA-N |
| Smiles | C1=CSC(=C1)C(=O)Cl |
| Isomeric SMILES | C1=CSC(=C1)C(=O)Cl |
| WGK Germany | 3 |
| PubChem CID | 78928 |
| Molecular Weight | 146.59 |
| Beilstein | 110145 |
| Reaxy-Rn | 110145 |
| Sensitivity | Moisture sensitive;Light sensitive |
|---|---|
| Refractive Index | 1.59 |
| Flash Point(°F) | 195.8 °F |
| Flash Point(°C) | 91 °C |
| Boil Point(°C) | 190 °C |
| Molecular Weight | 146.600 g/mol |
| XLogP3 | 2.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 145.959 Da |
| Monoisotopic Mass | 145.959 Da |
| Topological Polar Surface Area | 45.300 Ų |
| Heavy Atom Count | 8 |
| Formal Charge | 0 |
| Complexity | 105.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
Starting at $9.90
| 1. Nan Li, Shengfu Yang, Kan Zhang. (2023) Thiophene-Rich Benzoxazines with an Amide Moiety: Integration of Structural and Hydrogen Bonding Influence on the Polymerization Mechanism by Experimental and Computational Studies. MACROMOLECULES, 56 (17): (6667–6678). |
| 2. Linlin Cui, Li Zhao, Guanghuan Shen, Dahai Yu, Tian Yuan, Yingyu Zhang, Bo Yang. (2024) Antitumor Mechanism and Therapeutic Potential of Cordycepin Derivatives. MOLECULES, 29 (2): (483). |
| 3. Hui Dong, Weitian Chen, Ke Xu, Linlin Zheng, Bingyu Wei, Ruiyu Liu, Jingru Yang, Tao Wang, Yanli Zhou, Yintang Zhang, Maotian Xu. (2025) High Selectivity Fluorescence and Electrochemical Dual-Mode Detection of Glutathione in the Serum of Parkinson’s Disease Model Mice and Humans. ANALYTICAL CHEMISTRY, |