Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T170255-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$410.90
|
|
| Synonyms | 2-Tetradecyloxyaniline | 41710-89-8 | 2-(Tetradecyloxy)aniline | 2-Tetradecoxyaniline | Benzenamine, 2-(tetradecyloxy)- | O-TETRADECYLOXYANILINE | 2-myristyloxyaniline | EINECS 255-510-8 | SCHEMBL4950279 | DTXSID2068345 | AKOS003602424 | SB83093 | FT-0654370 | A825631 |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenol ethers |
| Subclass | Aminophenyl ethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aminophenyl ethers |
| Alternative Parents | Phenoxy compounds Aniline and substituted anilines Alkyl aryl ethers Primary amines Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Aminophenyl ether - Phenoxy compound - Aniline or substituted anilines - Alkyl aryl ether - Monocyclic benzene moiety - Ether - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Primary amine - Organooxygen compound - Organonitrogen compound - Amine - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aminophenyl ethers. These are aromatic compounds that contain a phenol ether, which carries an amine group on the benzene ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-tetradecoxyaniline |
|---|---|
| INCHI | InChI=1S/C20H35NO/c1-2-3-4-5-6-7-8-9-10-11-12-15-18-22-20-17-14-13-16-19(20)21/h13-14,16-17H,2-12,15,18,21H2,1H3 |
| InChIKey | IXZBAJOADDIGIP-UHFFFAOYSA-N |
| Smiles | CCCCCCCCCCCCCCOC1=CC=CC=C1N |
| Isomeric SMILES | CCCCCCCCCCCCCCOC1=CC=CC=C1N |
| PubChem CID | 117021 |
| Molecular Weight | 305.508 |
| Molecular Weight | 305.500 g/mol |
|---|---|
| XLogP3 | 7.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 14 |
| Exact Mass | 305.272 Da |
| Monoisotopic Mass | 305.272 Da |
| Topological Polar Surface Area | 35.300 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 232.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |