Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
O173779-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$527.90
|
|
Discover 2-oxa-5-azaspiro[3.4]octane hemioxalate by Aladdin Scientific in 97% for only $527.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 2-Oxa-5-azaspiro[3.4]octane hemioxalate | 1380571-82-3 | 2-Oxa-5-azaspiro[3.4]octane oxalate(2:1) | MFCD22373635 | AKOS032963024 | SB21695 | AS-34945 | bis(2-oxa-5-azaspiro[3.4]octane) oxalate | 2-Oxa-5-azaspiro[3.4]octaneoxalate(2:1) | CS-0051826 | A886319 | 2-Oxa-5-azaspiro[ |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Dicarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Dicarboxylic acids and derivatives |
| Alternative Parents | Pyrrolidines Oxetanes Oxacyclic compounds Dialkylamines Dialkyl ethers Carboxylic acids Azacyclic compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Not available |
| Substituents | Dicarboxylic acid or derivatives - Pyrrolidine - Oxetane - Carboxylic acid - Dialkyl ether - Secondary aliphatic amine - Ether - Secondary amine - Organoheterocyclic compound - Azacycle - Oxacycle - Organonitrogen compound - Organooxygen compound - Organic oxygen compound - Organic oxide - Amine - Carbonyl group - Organic nitrogen compound - Hydrocarbon derivative - Aliphatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as dicarboxylic acids and derivatives. These are organic compounds containing exactly two carboxylic acid groups. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-oxa-5-azaspiro[3.4]octane;oxalic acid |
|---|---|
| INCHI | InChI=1S/2C6H11NO.C2H2O4/c2*1-2-6(7-3-1)4-8-5-6;3-1(4)2(5)6/h2*7H,1-5H2;(H,3,4)(H,5,6) |
| InChIKey | GKPRXKGNXUGYIQ-UHFFFAOYSA-N |
| Smiles | C1CC2(COC2)NC1.C1CC2(COC2)NC1.C(=O)(C(=O)O)O |
| Isomeric SMILES | C1CC2(COC2)NC1.C1CC2(COC2)NC1.C(=O)(C(=O)O)O |
| Molecular Weight | 316.354 |
| Reaxy-Rn | 34433503 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=34433503&ln= |
| Molecular Weight | 316.350 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 1 |
| Exact Mass | 316.163 Da |
| Monoisotopic Mass | 316.163 Da |
| Topological Polar Surface Area | 117.000 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 170.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |