Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
N168075-25mg
|
25mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$410.90
|
|
Discover 2-NORBORNYLTRICHLOROSILANE by Aladdin Scientific in for only $410.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 18245-29-9 | 2-Trichlorosilylbicyclo[2.2.1]heptane | 2-bicyclo[2.2.1]heptanyl(trichloro)silane | Silane, bicyclo[2.2.1]hept-2-yltrichloro- | 2-Trichlorosilylbicyclo(2.2.1)heptane | bicyclo[2.2.1]heptan-2-yltrichlorosilane | Silane, bicyclo(2.2.1)hept-2-yltrichloro- | B |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Subclass | Monoterpenoids |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Bicyclic monoterpenoids |
| Alternative Parents | Organochlorosilanes Organic metalloid salts Alkylhalosilanes Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Substituents | Bicyclic monoterpenoid - Organoheterosilane - Organochlorosilane - Organic metalloid salt - Alkylhalosilane - Hydrocarbon derivative - Organic salt - Organosilicon compound - Aliphatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as bicyclic monoterpenoids. These are monoterpenoids containing exactly 2 rings, which are fused to each other. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-bicyclo[2.2.1]heptanyl(trichloro)silane |
|---|---|
| INCHI | InChI=1S/C7H11Cl3Si/c8-11(9,10)7-4-5-1-2-6(7)3-5/h5-7H,1-4H2 |
| InChIKey | FMUGJGVGEWHETE-UHFFFAOYSA-N |
| Smiles | C1CC2CC1CC2[Si](Cl)(Cl)Cl |
| Isomeric SMILES | C1CC2CC1CC2[Si](Cl)(Cl)Cl |
| Molecular Weight | 229.611 |
| Reaxy-Rn | 2935421 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2935421&ln= |
| Molecular Weight | 229.600 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 0 |
| Exact Mass | 227.97 Da |
| Monoisotopic Mass | 227.97 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 166.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 3 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |