Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
N159679-1g
|
1g |
5
|
$24.90
|
|
|
N159679-10g
|
10g |
2
|
$186.90
|
|
| Synonyms | CS-0185792 | Myristic Acid 2-Naphthyl Ester | InChI=1/C24H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-17-24(25)26-23-19-18-21-15-13-14-16-22(21)20-23/h13-16,18-20H,2-12,17H2,1H | NSC122046 | NSC-122046 | CHEBI:90249 | N-2350 | 2-Naphthylmyristate | Tetradecanoic aci |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Naphthalenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Naphthalenes |
| Alternative Parents | Fatty acid esters Carboxylic acid esters Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Naphthalene - Fatty acid ester - Fatty acyl - Carboxylic acid ester - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as naphthalenes. These are compounds containing a naphthalene moiety, which consists of two fused benzene rings. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488185995 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488185995 |
| IUPAC Name | naphthalen-2-yl tetradecanoate |
| INCHI | InChI=1S/C24H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-17-24(25)26-23-19-18-21-15-13-14-16-22(21)20-23/h13-16,18-20H,2-12,17H2,1H3 |
| InChIKey | SKRXBZIJSNMVFA-UHFFFAOYSA-N |
| Smiles | CCCCCCCCCCCCCC(=O)OC1=CC2=CC=CC=C2C=C1 |
| Isomeric SMILES | CCCCCCCCCCCCCC(=O)OC1=CC2=CC=CC=C2C=C1 |
| Molecular Weight | 354.53 |
| Reaxy-Rn | 3376764 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3376764&ln= |
| Melt Point(°C) | 67 °C |
|---|---|
| Molecular Weight | 354.500 g/mol |
| XLogP3 | 9.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 14 |
| Exact Mass | 354.256 Da |
| Monoisotopic Mass | 354.256 Da |
| Topological Polar Surface Area | 26.300 Ų |
| Heavy Atom Count | 26 |
| Formal Charge | 0 |
| Complexity | 365.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |