Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M141044-100ml
|
100ml |
1
|
$432.90
|
|
| Synonyms | 35293-35-7 | Neophylmagnesium chloride | Magnesium, chloro(2-methyl-2-phenylpropyl)- | 2-methyl-2-phenylpropylmagnesium chloride | magnesium;2-methanidylpropan-2-ylbenzene;chloride | 2-Methyl-2-phenylpropylmagnesium chloride, 0.50 M in THF | 2-Methyl-2-phenylpropylma |
|---|---|
| Specifications & Purity | 0.5 M in THF |
| Storage Temp | Store at 2-8°C,Argon charged |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Phenylpropanes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylpropanes |
| Alternative Parents | Organic metal halides Organic chloride salts Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenylpropane - Organic metal halide - Hydrocarbon derivative - Organic chloride salt - Organic salt - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylpropanes. These are organic compounds containing a phenylpropane moiety. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | magnesium;2-methanidylpropan-2-ylbenzene;chloride |
|---|---|
| INCHI | InChI=1S/C10H13.ClH.Mg/c1-10(2,3)9-7-5-4-6-8-9;;/h4-8H,1H2,2-3H3;1H;/q-1;;+2/p-1 |
| InChIKey | IYOKDPFKCXZKJU-UHFFFAOYSA-M |
| Smiles | CC(C)([CH2-])C1=CC=CC=C1.[Mg+2].[Cl-] |
| Isomeric SMILES | CC(C)([CH2-])C1=CC=CC=C1.[Mg+2].[Cl-] |
| WGK Germany | 1 |
| Molecular Weight | 192.97 |
| Reaxy-Rn | 3939696 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3939696&ln= |
| Sensitivity | Moisture sensitive;Heat sensitive |
|---|---|
| Molecular Weight | 192.970 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 192.056 Da |
| Monoisotopic Mass | 192.056 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 106.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |