Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M472551-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$265.90
|
|
| Synonyms | Hexene, dimethyl- | dimethylhexene | DTXSID40211774 | NSC 102776 | FT-0632649 | 2-METHYL-2-HEPTENE | EINECS 211-022-7 | 2-Methyl-2-heptene, 98% | 2-Heptene, 2-methyl- | 2-methyl-hept-2-ene | 2-Methylhept-2-ene | AKOS015912529 | NSC102776 | NSC-102776 |
|---|---|
| Specifications & Purity | ≥98% |
| Product Description |
Description 2-Methyl-2-heptene undergoes oxidation by singlet oxygen generated by the excitation of thiazine dyes cation to form hydroperoxides.2-Methyl-2-heptene was used in the functionalization of ethylene/5,7-dimethyl-1,6-diene copolymer with maleic anhydride via Alder Ene reaction. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Hydrocarbons |
| Class | Unsaturated hydrocarbons |
| Subclass | Branched unsaturated hydrocarbons |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Branched unsaturated hydrocarbons |
| Alternative Parents | Unsaturated aliphatic hydrocarbons Alkenes |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Branched unsaturated hydrocarbon - Unsaturated aliphatic hydrocarbon - Olefin - Alkene - Acyclic olefin - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as branched unsaturated hydrocarbons. These are hydrocarbons that contains one or more unsaturated carbon atoms, and an aliphatic branch. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-methylhept-2-ene |
|---|---|
| INCHI | InChI=1S/C8H16/c1-4-5-6-7-8(2)3/h7H,4-6H2,1-3H3 |
| InChIKey | WEPNJTDVIIKRIK-UHFFFAOYSA-N |
| Smiles | CCCCC=C(C)C |
| Isomeric SMILES | CCCCC=C(C)C |
| WGK Germany | 3 |
| Molecular Weight | 112.21 |
| Reaxy-Rn | 1732139 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1732139&ln= |
| Flash Point(°F) | 53.6 °F |
|---|---|
| Flash Point(°C) | 12 °C |
| Molecular Weight | 112.210 g/mol |
| XLogP3 | 3.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 3 |
| Exact Mass | 112.125 Da |
| Monoisotopic Mass | 112.125 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 8 |
| Formal Charge | 0 |
| Complexity | 66.100 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |