Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
H186959-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$205.90
|
|
| Synonyms | 2-HYDROXYPHENYLTRIFLUOROBORATE POTASSIUM SALT | FT-0648305 | POTASSIUM TRIFLUORO(2-HYDROXYPHENYL)BORATE | MFCD07781243 | 2-hydroxyphenyltrifluoroborate potassium salt, AldrichCPR | EN300-2302607 | Potassium 2-hydroxyphenyltrifluoroborate | AS-2998 | A9151 |
|---|---|
| Specifications & Purity | ≥95% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenols |
| Subclass | 1-hydroxy-4-unsubstituted benzenoids |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 1-hydroxy-4-unsubstituted benzenoids |
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids Benzene and substituted derivatives Boronic acid derivatives Organic metalloid salts Organic metal halides Organooxygen compounds Organometalloid compounds Organic potassium salts Hydrocarbon derivatives Organic cations |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | 1-hydroxy-4-unsubstituted benzenoid - 1-hydroxy-2-unsubstituted benzenoid - Monocyclic benzene moiety - Boronic acid derivative - Organic metal halide - Organic alkali metal salt - Organic metalloid salt - Organic oxygen compound - Hydrocarbon derivative - Organic potassium salt - Organic salt - Organooxygen compound - Organic metalloid moeity - Organic cation - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 1-hydroxy-4-unsubstituted benzenoids. These are phenols that are unsubstituted at the 4-position. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | potassium;trifluoro-(2-hydroxyphenyl)boranuide |
|---|---|
| INCHI | InChI=1S/C6H5BF3O.K/c8-7(9,10)5-3-1-2-4-6(5)11;/h1-4,11H;/q-1;+1 |
| InChIKey | GNJVFVXTMQKQGP-UHFFFAOYSA-N |
| Smiles | [B-](C1=CC=CC=C1O)(F)(F)F.[K+] |
| Isomeric SMILES | [B-](C1=CC=CC=C1O)(F)(F)F.[K+] |
| PubChem CID | 23680958 |
| Molecular Weight | 200 |
| Molecular Weight | 200.010 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 0 |
| Exact Mass | 200.002 Da |
| Monoisotopic Mass | 200.002 Da |
| Topological Polar Surface Area | 20.200 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 141.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |