Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
H179423-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,175.90
|
|
| Synonyms | 1111110-54-3 | 6-(4-(Trifluoromethyl)phenyl)pyridin-2-ol | 2-HYDROXY-6-(4-TRIFLUOROMETHYLPHENYL)PYRIDINE | 6-[4-(trifluoromethyl)phenyl]-1H-pyridin-2-one | DTXSID90671743 | DWKCKXNQFDMEDU-UHFFFAOYSA-N | MFCD11876114 | AKOS015892184 | SB55325 | BS-25141 | 6-[4-(Trifluoromethy |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Phenylpyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylpyridines |
| Alternative Parents | Trifluoromethylbenzenes Pyridinones Dihydropyridines Heteroaromatic compounds Lactams Azacyclic compounds Organooxygen compounds Organonitrogen compounds Organofluorides Organic oxides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 2-phenylpyridine - Trifluoromethylbenzene - Dihydropyridine - Pyridinone - Monocyclic benzene moiety - Hydropyridine - Benzenoid - Heteroaromatic compound - Lactam - Azacycle - Alkyl fluoride - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Organic oxide - Organic oxygen compound - Organic nitrogen compound - Alkyl halide - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylpyridines. These are polycyclic aromatic compounds containing a benzene ring linked to a pyridine ring through a CC or CN bond. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 6-[4-(trifluoromethyl)phenyl]-1H-pyridin-2-one |
|---|---|
| INCHI | InChI=1S/C12H8F3NO/c13-12(14,15)9-6-4-8(5-7-9)10-2-1-3-11(17)16-10/h1-7H,(H,16,17) |
| InChIKey | DWKCKXNQFDMEDU-UHFFFAOYSA-N |
| Smiles | C1=CC(=O)NC(=C1)C2=CC=C(C=C2)C(F)(F)F |
| Isomeric SMILES | C1=CC(=O)NC(=C1)C2=CC=C(C=C2)C(F)(F)F |
| Molecular Weight | 239.2 |
| Reaxy-Rn | 23420718 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=23420718&ln= |
| Molecular Weight | 239.190 g/mol |
|---|---|
| XLogP3 | 2.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 239.056 Da |
| Monoisotopic Mass | 239.056 Da |
| Topological Polar Surface Area | 29.100 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 362.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |