Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
E404389-1ml
|
1ml |
3
|
$87.90
|
|
|
E404389-5ml
|
5ml |
3
|
$364.90
|
|
| Synonyms | 1,4-Dimethyl-2-ethyl benzene | 2,5-Dimethylethylbenzene | 1,4-Dimethyl-2-ethylbenzene | 1,4-dimethyl-2-ethyl-benzene | A881547 | 2-Ethyl-p-xylene | NSC74186 | NSC-74186 | AXIUBBVSOWPLDA-UHFFFAOYSA-N | BAA75888 | DTXSID0061951 | 2-ETHYL-1,4-DIMETHYLBENZENE |
|---|---|
| Specifications & Purity | ≥98% |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Xylenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | p-Xylenes |
| Alternative Parents | Aromatic hydrocarbons Unsaturated hydrocarbons |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | P-xylene - Aromatic hydrocarbon - Unsaturated hydrocarbon - Hydrocarbon - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as p-xylenes. These are aromatic compounds that contain a p-xylene moiety, which is a monocyclic benzene carrying exactly two methyl groups at the 1- and 4-positions. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504752690 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504752690 |
| IUPAC Name | 2-ethyl-1,4-dimethylbenzene |
| INCHI | InChI=1S/C10H14/c1-4-10-7-8(2)5-6-9(10)3/h5-7H,4H2,1-3H3 |
| InChIKey | AXIUBBVSOWPLDA-UHFFFAOYSA-N |
| Smiles | CCC1=C(C=CC(=C1)C)C |
| Isomeric SMILES | CCC1=C(C=CC(=C1)C)C |
| UN Number | 3295 |
| Packing Group | III |
| Molecular Weight | 134.22 |
| Reaxy-Rn | 2039096 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2039096&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jun 10, 2023 | E404389 | |
| Certificate of Analysis | Jun 10, 2023 | E404389 | |
| Certificate of Analysis | Jun 10, 2023 | E404389 | |
| Certificate of Analysis | Jun 10, 2023 | E404389 |
| Refractive Index | 1.5 |
|---|---|
| Flash Point(°C) | 59 °C |
| Boil Point(°C) | 187 °C |
| Melt Point(°C) | -54 °C |
| Molecular Weight | 134.220 g/mol |
| XLogP3 | 3.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 1 |
| Exact Mass | 134.11 Da |
| Monoisotopic Mass | 134.11 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 96.200 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |