Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D166569-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$605.90
|
|
Discover 2-(Dimethoxymethyl)-6-fluoro-1,8-naphthyridine by Aladdin Scientific in for only $605.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | DTXSID60678401 | 2-(Dimethoxymethyl)-6-fluoro-1,8-naphthyridine, AldrichCPR | 1,8-Naphthyridine, 2-(dimethoxymethyl)-6-fluoro- | BS-42494 | MFCD16628233 | FT-0681936 | 2-(Dimethoxymethyl)-6-fluoro-1,8-naphthyridine | AKOS015851392 | 1222533-72-3 | XYB5337 |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazanaphthalenes |
| Subclass | Naphthyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Naphthyridines |
| Alternative Parents | Pyridines and derivatives Aryl fluorides Heteroaromatic compounds Azacyclic compounds Acetals Organopnictogen compounds Organonitrogen compounds Organofluorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Naphthyridine - Aryl fluoride - Aryl halide - Pyridine - Heteroaromatic compound - Acetal - Azacycle - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Hydrocarbon derivative - Organopnictogen compound - Organic oxygen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as naphthyridines. These are compounds containing a naphthyridine moiety, a naphthalene in which a carbon atom has been replaced by a nitrogen in each of the two rings. The naphthyridine skeleton can also be described as an assembly two fused pyridine rings, which do not share their nitrogen atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-(dimethoxymethyl)-6-fluoro-1,8-naphthyridine |
|---|---|
| INCHI | InChI=1S/C11H11FN2O2/c1-15-11(16-2)9-4-3-7-5-8(12)6-13-10(7)14-9/h3-6,11H,1-2H3 |
| InChIKey | DAVIBRODJFTHQN-UHFFFAOYSA-N |
| Smiles | COC(C1=NC2=NC=C(C=C2C=C1)F)OC |
| Isomeric SMILES | COC(C1=NC2=NC=C(C=C2C=C1)F)OC |
| WGK Germany | 3 |
| PubChem CID | 49761597 |
| Molecular Weight | 222.22 |
| Molecular Weight | 222.220 g/mol |
|---|---|
| XLogP3 | 1.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 3 |
| Exact Mass | 222.08 Da |
| Monoisotopic Mass | 222.08 Da |
| Topological Polar Surface Area | 44.200 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 226.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |