Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C186505-1g
|
1g |
2
|
$121.90
|
|
|
C186505-5g
|
5g |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$534.90
|
|
| Synonyms | 766557-62-4 | 2-Cyclopropylmethoxy-3-iodo-pyridine | 2-(cyclopropylmethoxy)-3-iodopyridine | 2-CYCLOPROPYLMETHOXY-3-IODOPYRIDINE | SCHEMBL760442 | DTXSID60590331 | ILSBVXOYWKUWLJ-UHFFFAOYSA-N | MFCD06659010 | AKOS015840788 | AB25870 | AS-81333 | 2-(cyclopropylmethoxy)-3-iodany |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Ethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Alkyl aryl ethers |
| Alternative Parents | Pyridines and derivatives Aryl iodides Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organoiodides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Alkyl aryl ether - Pyridine - Aryl iodide - Aryl halide - Heteroaromatic compound - Azacycle - Organoheterocyclic compound - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Organoiodide - Organohalogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alkyl aryl ethers. These are organic compounds containing the alkyl aryl ether functional group with the generic formula R-O-R' , where R is an alkyl group and R' is an aryl group. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504768606 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504768606 |
| IUPAC Name | 2-(cyclopropylmethoxy)-3-iodopyridine |
| INCHI | InChI=1S/C9H10INO/c10-8-2-1-5-11-9(8)12-6-7-3-4-7/h1-2,5,7H,3-4,6H2 |
| InChIKey | ILSBVXOYWKUWLJ-UHFFFAOYSA-N |
| Smiles | C1CC1COC2=C(C=CC=N2)I |
| Isomeric SMILES | C1CC1COC2=C(C=CC=N2)I |
| Molecular Weight | 275.1 |
| Reaxy-Rn | 31921754 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=31921754&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jan 10, 2024 | C186505 | |
| Certificate of Analysis | Jan 10, 2024 | C186505 | |
| Certificate of Analysis | Jan 10, 2024 | C186505 |
| Sensitivity | Hygroscopic |
|---|---|
| Molecular Weight | 275.090 g/mol |
| XLogP3 | 2.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 3 |
| Exact Mass | 274.981 Da |
| Monoisotopic Mass | 274.981 Da |
| Topological Polar Surface Area | 22.100 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 149.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |