Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C181990-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$374.90
|
|
Discover 2-(Chloromethyl)-4h-pyrido[1,2-a]pyrimidin-4-one by Aladdin Scientific in 98% for only $374.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 2-(chloromethyl)-4H-pyrido[1,2-a]pyrimidin-4-one | 16867-35-9 | 2-(chloromethyl)pyrido[1,2-a]pyrimidin-4-one | SCHEMBL890385 | 4H-Pyrido[1,2-a]pyrimidin-4-one,2-(chloromethyl)- | 2-(chloromethyl)-5-hydropyridino[1,2-a]pyrimidin-4-one | DTXSID40408965 | QANDFEYEAYUSKD-U |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridopyrimidines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyridopyrimidines |
| Alternative Parents | Pyrimidones Pyridines and derivatives Heteroaromatic compounds Lactams Azacyclic compounds Organooxygen compounds Organonitrogen compounds Organochlorides Organic oxides Hydrocarbon derivatives Alkyl chlorides |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Pyridopyrimidine - Pyrimidone - Pyridine - Pyrimidine - Heteroaromatic compound - Lactam - Azacycle - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Alkyl halide - Alkyl chloride - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyridopyrimidines. These are compounds containing a pyridopyrimidine, which consists of a pyridine fused to a pyrimidine. Pyridine is 6-membered ring consisting of five carbon atoms and a nitrogen atom. Pyrimidine is a 6-membered ring consisting of four carbon atoms and two nitrogen centers at the 1- and 3- ring positions. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-(chloromethyl)pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| INCHI | InChI=1S/C9H7ClN2O/c10-6-7-5-9(13)12-4-2-1-3-8(12)11-7/h1-5H,6H2 |
| InChIKey | QANDFEYEAYUSKD-UHFFFAOYSA-N |
| Smiles | C1=CC2=NC(=CC(=O)N2C=C1)CCl |
| Isomeric SMILES | C1=CC2=NC(=CC(=O)N2C=C1)CCl |
| Molecular Weight | 194.6 |
| Reaxy-Rn | 777824 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=777824&ln= |
| Molecular Weight | 194.620 g/mol |
|---|---|
| XLogP3 | 0.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 194.025 Da |
| Monoisotopic Mass | 194.025 Da |
| Topological Polar Surface Area | 32.700 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 366.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |