Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C179909-100g
|
100g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,566.90
|
|
Discover 2-Chloro-N-methylaniline, HCl by Aladdin Scientific in 98% for only $1,566.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 2-Chloro-N-methylaniline hydrochloride | 1187385-64-3 | 2-Chloro-N-methylaniline, HCl | 2-chloro-N-methylaniline;hydrochloride | 2-Chloro-N-methylaniline HCl | 2-Chloro-N-methylanilinehydrochloride | 2-Chloro-N-methylaniline,hcl | DTXSID50675161 | MFCD12756437 | AKOS015908 |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Amines |
| Intermediate Tree Nodes | Aralkylamines |
| Direct Parent | Phenylalkylamines |
| Alternative Parents | Aniline and substituted anilines Secondary alkylarylamines Chlorobenzenes Aryl chlorides Organochlorides Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenylalkylamine - Aniline or substituted anilines - Secondary aliphatic/aromatic amine - Halobenzene - Chlorobenzene - Benzenoid - Monocyclic benzene moiety - Aryl halide - Aryl chloride - Secondary amine - Hydrocarbon derivative - Hydrochloride - Organochloride - Organohalogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylalkylamines. These are organic amines where the amine group is secondary and linked on one end to a phenyl group and on the other end, to an alkyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-chloro-N-methylaniline;hydrochloride |
|---|---|
| INCHI | InChI=1S/C7H8ClN.ClH/c1-9-7-5-3-2-4-6(7)8;/h2-5,9H,1H3;1H |
| InChIKey | BAICYTXRERVYMP-UHFFFAOYSA-N |
| Smiles | CNC1=CC=CC=C1Cl.Cl |
| Isomeric SMILES | CNC1=CC=CC=C1Cl.Cl |
| PubChem CID | 46739562 |
| Molecular Weight | 178.1 |
| Molecular Weight | 178.060 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 1 |
| Exact Mass | 177.011 Da |
| Monoisotopic Mass | 177.011 Da |
| Topological Polar Surface Area | 12.000 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 85.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |