Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C188471-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,223.90
|
|
Discover 2-Chloro-6-cyclopropylaminopyrazine by Aladdin Scientific in 97% for only $1,223.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 6-chloro-N-cyclopropylpyrazin-2-amine | 941294-47-9 | 2-Chloro-6-cyclopropylaminopyrazine | SCHEMBL12615604 | DTXSID80674309 | TYAIEHCRGITGEM-UHFFFAOYSA-N | MFCD09800961 | 6-Chloro-N-cyclopropyl-2-pyrazinamine | AKOS009154412 | MB07688 | BP-20041 | BS-24865 | CS-0212458 | A859560 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazines |
| Subclass | Pyrazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aminopyrazines |
| Alternative Parents | Secondary alkylarylamines Imidolactams Aryl chlorides Heteroaromatic compounds Azacyclic compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Secondary aliphatic/aromatic amine - Aminopyrazine - Imidolactam - Aryl halide - Aryl chloride - Heteroaromatic compound - Azacycle - Secondary amine - Organic nitrogen compound - Hydrocarbon derivative - Organonitrogen compound - Organochloride - Organohalogen compound - Amine - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aminopyrazines. These are organic compounds containing an amino group attached to a pyrazine ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 6-chloro-N-cyclopropylpyrazin-2-amine |
|---|---|
| INCHI | InChI=1S/C7H8ClN3/c8-6-3-9-4-7(11-6)10-5-1-2-5/h3-5H,1-2H2,(H,10,11) |
| InChIKey | TYAIEHCRGITGEM-UHFFFAOYSA-N |
| Smiles | C1CC1NC2=CN=CC(=N2)Cl |
| Isomeric SMILES | C1CC1NC2=CN=CC(=N2)Cl |
| Molecular Weight | 169.6 |
| Reaxy-Rn | 22954199 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=22954199&ln= |
| Molecular Weight | 169.610 g/mol |
|---|---|
| XLogP3 | 1.600 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 169.041 Da |
| Monoisotopic Mass | 169.041 Da |
| Topological Polar Surface Area | 37.800 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 138.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |