Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C165899-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$48.90
|
|
Discover 2-Chloro-5-(trifluoromethyl)pyridine-3-carbonyl chloride by Aladdin Scientific in 97% for only $48.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | SCHEMBL2634725 | 1099597-75-7 | MFCD11226642 | DTXSID00653378 | 2-Chloro-5-(trifluoromethyl)pyridine-3-carbonyl chloride | 2-CHLORO-5-(TRIFLUOROMETHYL)PYRIDINE-3-CARBONYLCHLORIDE | 2-Chloro-5-(trifluoromethyl)pyridine-3-carbonyl chloride, 97% | 2-chloro-5 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at -20°C |
| Shipped In |
Ice chest + Ice pads This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Pyridinecarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyridinecarboxylic acids and derivatives |
| Alternative Parents | 2-halopyridines Aryl chlorides Vinylogous halides Heteroaromatic compounds Azacyclic compounds Acyl chlorides Organooxygen compounds Organonitrogen compounds Organofluorides Organochlorides Organic oxides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyridine carboxylic acid or derivatives - 2-halopyridine - Aryl chloride - Aryl halide - Vinylogous halide - Heteroaromatic compound - Azacycle - Acyl chloride - Acyl halide - Organic oxide - Organooxygen compound - Organonitrogen compound - Organofluoride - Organochloride - Organohalogen compound - Organic oxygen compound - Organic nitrogen compound - Alkyl halide - Alkyl fluoride - Hydrocarbon derivative - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyridinecarboxylic acids and derivatives. These are compounds containing a pyridine ring bearing a carboxylic acid group or a derivative thereof. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-chloro-5-(trifluoromethyl)pyridine-3-carbonyl chloride |
|---|---|
| INCHI | InChI=1S/C7H2Cl2F3NO/c8-5-4(6(9)14)1-3(2-13-5)7(10,11)12/h1-2H |
| InChIKey | CEQQAPUZEUIPCH-UHFFFAOYSA-N |
| Smiles | C1=C(C=NC(=C1C(=O)Cl)Cl)C(F)(F)F |
| Isomeric SMILES | C1=C(C=NC(=C1C(=O)Cl)Cl)C(F)(F)F |
| WGK Germany | 3 |
| Molecular Weight | 243.99 |
| Reaxy-Rn | 22037940 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=22037940&ln= |
| Flash Point(°F) | >230 °F |
|---|---|
| Flash Point(°C) | >110 °C |
| Molecular Weight | 243.990 g/mol |
| XLogP3 | 3.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 1 |
| Exact Mass | 242.947 Da |
| Monoisotopic Mass | 242.947 Da |
| Topological Polar Surface Area | 30.000 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 233.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |